Przejdź do treściPrzejdź do informacji o dostępnościMenu skrótów klawiszowych
Logo OpenStax
Fizyka dla szkół wyższych. Tom 3

6.1 Promieniowanie ciała doskonale czarnego

Fizyka dla szkół wyższych. Tom 36.1 Promieniowanie ciała doskonale czarnego

Menu
Spis treści
  1. Przedmowa
  2. Optyka
    1. 1 Natura światła
      1. Wstęp
      2. 1.1 Rozchodzenie się światła
      3. 1.2 Prawo odbicia
      4. 1.3 Załamanie
      5. 1.4 Całkowite wewnętrzne odbicie
      6. 1.5 Rozszczepienie
      7. 1.6 Zasada Huygensa
      8. 1.7 Polaryzacja
      9. Podsumowanie rozdziału
        1. Kluczowe pojęcia
        2. Najważniejsze wzory
        3. Podsumowanie
        4. Pytania
        5. Zadania
        6. Zadania dodatkowe
        7. Zadania trudniejsze
    2. 2 Optyka geometryczna i tworzenie obrazu
      1. Wstęp
      2. 2.1 Obrazy tworzone przez zwierciadła płaskie
      3. 2.2 Zwierciadła sferyczne
      4. 2.3 Obrazy tworzone przez załamanie promieni światła
      5. 2.4 Cienkie soczewki
      6. 2.5 Oko
      7. 2.6 Aparat fotograficzny
      8. 2.7 Proste przyrządy powiększające
      9. 2.8 Mikroskopy i teleskopy
      10. Podsumowanie rozdziału
        1. Kluczowe pojęcia
        2. Najważniejsze wzory
        3. Podsumowanie
        4. Pytania
        5. Zadania
        6. Zadania dodatkowe
    3. 3 Interferencja
      1. Wstęp
      2. 3.1 Doświadczenie Younga z dwiema szczelinami
      3. 3.2 Matematyczny opis interferencji
      4. 3.3 Interferencja na wielu szczelinach
      5. 3.4 Interferencja w cienkich warstwach
      6. 3.5 Interferometr Michelsona
      7. Podsumowanie rozdziału
        1. Kluczowe pojęcia
        2. Najważniejsze wzory
        3. Podsumowanie
        4. Pytania
        5. Zadania
        6. Zadania dodatkowe
        7. Zadania trudniejsze
    4. 4 Dyfrakcja
      1. Wstęp
      2. 4.1 Dyfrakcja na pojedynczej szczelinie
      3. 4.2 Natężenie światła w dyfrakcji na pojedynczej szczelinie
      4. 4.3 Dyfrakcja na podwójnej szczelinie
      5. 4.4 Siatki dyfrakcyjne
      6. 4.5 Otwory kołowe i rozdzielczość
      7. 4.6 Dyfrakcja rentgenowska
      8. 4.7 Holografia
      9. Podsumowanie rozdziału
        1. Kluczowe pojęcia
        2. Najważniejsze wzory
        3. Podsumowanie
        4. Pytania
        5. Zadania
        6. Zadania dodatkowe
        7. Zadania trudniejsze
  3. Fizyka współczesna
    1. 5 Teoria względności
      1. Wstęp
      2. 5.1 Niezmienność praw fizyki
      3. 5.2 Względność jednoczesności zdarzeń
      4. 5.3 Dylatacja czasu
      5. 5.4 Skrócenie długości w szczególnej teorii względności
      6. 5.5 Transformacja Lorentza
      7. 5.6 Względność prędkości w szczególnej teorii względności
      8. 5.7 Relatywistyczny efekt Dopplera
      9. 5.8 Pęd relatywistyczny
      10. 5.9 Energia relatywistyczna
      11. Podsumowanie rozdziału
        1. Kluczowe pojęcia
        2. Najważniejsze wzory
        3. Podsumowanie
        4. Pytania
        5. Zadania
        6. Zadania dodatkowe
    2. 6 Fotony i fale materii
      1. Wstęp
      2. 6.1 Promieniowanie ciała doskonale czarnego
      3. 6.2 Efekt fotoelektryczny
      4. 6.3 Efekt Comptona
      5. 6.4 Model atomu wodoru Bohra
      6. 6.5 Fale de Broglie’a
      7. 6.6 Dualizm korpuskularno-falowy
      8. Podsumowanie rozdziału
        1. Kluczowe pojęcia
        2. Najważniejsze wzory
        3. Podsumowanie
        4. Pytania
        5. Zadania
        6. Zadania dodatkowe
    3. 7 Mechanika kwantowa
      1. Wstęp
      2. 7.1 Funkcje falowe
      3. 7.2 Zasada nieoznaczoności Heisenberga
      4. 7.3 Równanie Schrӧdingera
      5. 7.4 Cząstka kwantowa w pudełku
      6. 7.5 Kwantowy oscylator harmoniczny
      7. 7.6 Tunelowanie cząstek przez bariery potencjału
      8. Podsumowanie rozdziału
        1. Kluczowe pojęcia
        2. Najważniejsze wzory
        3. Podsumowanie
        4. Pytania
        5. Zadania
        6. Zadania dodatkowe
        7. Zadania trudniejsze
    4. 8 Budowa atomu
      1. Wstęp
      2. 8.1 Atom wodoru
      3. 8.2 Orbitalny magnetyczny moment dipolowy elektronu
      4. 8.3 Spin elektronu
      5. 8.4 Zakaz Pauliego i układ okresowy pierwiastków
      6. 8.5 Widma atomowe i promieniowanie rentgenowskie
      7. 8.6 Lasery
      8. Podsumowanie rozdziału
        1. Kluczowe pojęcia
        2. Najważniejsze wzory
        3. Podsumowanie
        4. Pytania
        5. Zadania
        6. Zadania dodatkowe
    5. 9 Fizyka materii skondensowanej
      1. Wstęp
      2. 9.1 Rodzaje wiązań cząsteczkowych
      3. 9.2 Widma cząsteczkowe
      4. 9.3 Wiązania w ciałach stałych
      5. 9.4 Model elektronów swobodnych w metalach
      6. 9.5 Teoria pasmowa ciał stałych
      7. 9.6 Półprzewodniki i domieszkowanie
      8. 9.7 Przyrządy półprzewodnikowe
      9. 9.8 Nadprzewodnictwo
      10. Podsumowanie rozdziału
        1. Kluczowe pojęcia
        2. Najważniejsze wzory
        3. Podsumowanie
        4. Pytania
        5. Zadania
        6. Zadania dodatkowe
        7. Zadania trudniejsze
    6. 10 Fizyka jądrowa
      1. Wstęp
      2. 10.1 Własności jądra atomowego
      3. 10.2 Energia wiązania jądra
      4. 10.3 Rozpad promieniotwórczy
      5. 10.4 Procesy rozpadu
      6. 10.5 Rozszczepienie jądra atomowego
      7. 10.6 Fuzja jądrowa
      8. 10.7 Skutki biologiczne i zastosowania medyczne promieniowania jądrowego
      9. Podsumowanie rozdziału
        1. Kluczowe pojęcia
        2. Najważniejsze wzory
        3. Podsumowanie
        4. Pytania
        5. Zadania
        6. Zadania dodatkowe
        7. Zadania trudniejsze
    7. 11 Fizyka cząstek elementarnych i kosmologia
      1. Wstęp
      2. 11.1 Wstęp do fizyki cząstek elementarnych
      3. 11.2 Zasady zachowania w fizyce cząstek elementarnych
      4. 11.3 Kwarki
      5. 11.4 Akceleratory i detektory cząstek
      6. 11.5 Model standardowy
      7. 11.6 Wielki Wybuch
      8. 11.7 Ewolucja wczesnego Wszechświata
      9. Podsumowanie rozdziału
        1. Kluczowe pojęcia
        2. Najważniejsze wzory
        3. Podsumowanie
        4. Pytania
        5. Zadania
        6. Zadania dodatkowe
        7. Zadania trudniejsze
  4. A Jednostki
  5. B Przeliczanie jednostek
  6. C Najważniejsze stałe fizyczne
  7. D Dane astronomiczne
  8. E Wzory matematyczne
  9. F Układ okresowy pierwiastków
  10. G Alfabet grecki
  11. Rozwiązania zadań
    1. Rozdział 1
    2. Rozdział 2
    3. Rozdział 3
    4. Rozdział 4
    5. Rozdział 5
    6. Rozdział 6
    7. Rozdział 7
    8. Rozdział 8
    9. Rozdział 9
    10. Rozdział 10
    11. Rozdział 11
  12. Skorowidz nazwisk
  13. Skorowidz rzeczowy
  14. Skorowidz terminów obcojęzycznych

Cel dydaktyczny

W tym podrozdziale nauczysz się:
  • stosować prawa Wiena i Stefana-Boltzmanna do analizy promieniowania ciała doskonale czarnego;
  • wyjaśniać hipotezę Plancka dotyczącą kwantów energii.

Wszystkie ciała emitują promieniowanie elektromagnetyczne o szerokim zakresie długości fal. W jednym z wcześniejszych rozdziałów dowiedzieliśmy się, że zimniejsze ciało wypromieniowuje mniej energii niż ciało cieplejsze. Z doświadczenia wiemy także, że gdy ciało jest podgrzewane i jego temperatura rośnie, obserwowana barwa promieniowania emitowanego przez nie zmienia się z podczerwonej na czerwoną, z czerwonej na pomarańczową i tak dalej. Wraz ze wzrostem temperatury rozgrzane ciało przybiera barwy odpowiadające coraz mniejszym długościom fal. Jest to podstawowa zasada działania żarówki: gorące metalowe włókno najpierw świeci na czerwono, a gdy rozgrzewa się bardziej, emitowane przez nie światło obejmuje całe widzialne widmo fal elektromagnetycznych. Temperatura (TT) obiektu emitującego promieniowanie, zwanego emiterem (ang. emitter), determinuje długość fali odpowiadającej maksimum wypromieniowanej energii. Przykładowo Słońce, którego powierzchnia ma temperaturę pomiędzy 5000K5000K \SI{5000}{\kelvin} a 6000K6000K \SI{6000}{\kelvin}, promieniuje najmocniej w zakresie fal o długości około 560nm560nm \SI{560}{\nano\metre}, w widzialnej części spektrum elektromagnetycznego. Twoje ciało, gdy ma normalną temperaturę, około 300K300K \SI{300}{\kelvin}, promieniuje najmocniej w zakresie podczerwonej części spektrum.

Promieniowanie padające na obiekt jest częściowo absorbowane, a częściowo odbijane. W równowadze termodynamicznej szybkość, z jaką ciało absorbuje promieniowanie jest taka sama jak szybkość, z jaką je emituje. Dlatego dobry absorber promieniowania jest także dobrym emiterem. Idealny absorber pochłania całe padające na niego promieniowanie; nazywamy go ciałem doskonale czarnym (ang. blackbody).

Ponieważ żaden rzeczywisty materiał nie absorbuje 100%100% \SI{100}{\percent} promieniowania, ciało doskonale czarne jest tylko pewną idealizacją. Można jednak zbudować zachowujący się bardzo podobnie model w postaci wnęki z niewielkim otworem, której wewnętrzna powierzchnia jest pomalowana na czarno, jak pokazano na Ilustracji 6.2. Fale elektromagnetyczne wpadające do takiej wnęki, odbijają się wielokrotnie i są niemal w całości pochłaniane. W stanie równowagi termodynamicznej (w temperaturze TT T) ściany wnęki absorbują dokładnie tyle samo promieniowania, co emitują. Mierzone spektrum emisji jest bardzo bliskie spektrum ciała doskonale czarnego. Fale elektromagnetyczne emitowane przez ciało doskonale czarne nazywamy promieniowaniem ciała doskonale czarnego (ang. blackbody radiation).

 Zdjęcie przedstawia model ciała doskonale czarnego, w postaci wnęki z niewielkim otworem. Fala elektromagnetyczna wpada do wnętrza i odbija się wiele razy od ścian.
Ilustracja 6.2 Dobrym modelem ciała doskonale czarnego jest wnęka z niewielkim otworem.

Natężenie IλTIλT I\apply(\lambda, T) promieniowania ciała doskonale czarnego zależy od długości fali λλ \lambda emitowanego promieniowania oraz od temperatury TT T tego ciała (Ilustracja 6.3). Funkcja IλTIλT I\apply(\lambda, T) opisuje natężenie (ang. power intensity) przypadające na jednostkę długości fali; innymi słowy moc promieniowania na jednostkę powierzchni otworu we wnęce, przez którą emitowane jest promieniowanie, na jednostkę długości fali. Zgodnie z tą definicją IλTdλIλTdλ I\apply(\lambda, T)\d\lambda wyraża moc promieniowania na jednostkę powierzchni, wyemitowanego w przedziale długości fal od λλ \lambda do λ+dλλ+dλ \lambda+\d\lambda. Rozkład natężenia w funkcji długości fali promieniowania emitowanego przez wnęki badany był eksperymentalnie pod koniec dziewiętnastego wieku. Stwierdzono, że rozkład taki tylko w przybliżeniu odpowiada rozkładowi natężenia promieniowania ciała doskonale czarnego (Ilustracja 6.4). Z dużą dokładnością natomiast wykresy natężenia promieniowania pochodzącego z gwiazd odpowiadają wykresom opisującym promieniowanie ciała doskonale czarnego.

 Wykres przedstawia zależność natężenia promieniowania ciała doskonale czarnego od długości fali wyrażonej w mikrometrach. Pięć krzywych odpowiada temperaturom 2000 K, 3000 K, 4000 K, and 5000 K. Maksimum natężenia promieniowania przesuwa się w kierunku krótszych fal wraz ze wzrostem temperatury. Jest wdalekiej podczerwieni dla 2000K, bliskiej podczerwieni dla 3000K, czerwonej części zakresu widzialnego dla 4000K, zielonej części zakresu widzialnego dla 5000K
Ilustracja 6.3 Natężenie promieniowania ciała doskonale czarnego w funkcji długości wyemitowanej fali. Każda krzywa odpowiada innej temeraturze ciała, zaczynając od niskiej temperatury (najniższa krzywa), kończąc na wysokiej (najwyższa).
 Wykres przedstawia zależność natężenia promieniowania od długości fali, w przypadku powierzchni kwarcowej i ciała doskonale czarnego w temperaturze 600K. Oba widma mają maksimum w podczerwieni przy długości fali około 4 mikrometrów. Natężenie promieniowania ciała doskonale czarnego stopniowo zmniejsza się z temperaturą, w przypadku kwarcu natężenie zmniejsza się dużo szybciej, a następnie występuje drugie mniejsze maksimum dla fali 10 mikrometrowej.
Ilustracja 6.4 Spektrum promieniowania wyemitowanego przez powierzchnię kwarcową (niebieska krzywa) oraz przez ciało doskonale czarne (czarna krzywa) w temperaturze 600 K 600 K \SI{600}{\kelvin} .

W doświadczeniach z promieniowaniem ciała doskonale czarnego można zaobserwować dwa istotne prawa: prawo przesunięć Wiena oraz prawo Stefana-Boltzmanna. Pierwsze z nich zobrazowane jest krzywą łączącą maksima krzywych natężenia (Ilustracja 6.3). Na wykresie widzimy, że im gorętsze ciało, tym mniejsza długość fali odpowiadającej maksimum natężenia. Ilościowo prawo Wiena opisujemy następującym wzorem

λ max T = 2,898 10 -3 m K , λ max T = 2,898 10 -3 m K , \lambda_{\text{max}}T=\SI{2,898e-3}{\metre\kelvin}\text{,}
6.1

gdzie λmaxλmax \lambda_{\text{max}} jest długością fali odpowiadającą maksimum rozkładu spektralnego promieniowania, zwanego też krzywą promieniowania. Innymi słowy, λmaxλmax \lambda_{\text{max}} jest długością fali, przy której ciało doskonale czarne promieniuje najsilniej w danej temperaturze TT T. Zauważmy, że w tym wzorze (Równanie 6.1) temperatura wyrażona jest w kelwinach. Prawo przesunięć Wiena pozwala nam oszacować temperaturę odległych gwiazd poprzez pomiar długości emitowanego przez nie promieniowania.

Przykład 6.1

Temperatura odległych gwiazd

Przy bezchmurnym niebie w zimowe miesiące na półkuli północnej obserwować można konstelację Oriona. Jedna z gwiazd tej konstelacji, Rigel, świeci na niebiesko, natomiast druga – Betelgeza (ang. Betelgeuse) – ma kolor lekko czerwony (Ilustracja 6.5). Która z tych gwiazd jest chłodniejsza, Betelgeza czy Rigel?

Strategia rozwiązania

Wiemy, że promieniowanie gwiazd opisywane jest tak samo jak promieniowanie ciała doskonale czarnego. Zgodnie z prawem Wiena ich temperatura jest odwrotnie proporcjonalna do długości fali odpowiadającej maksimum natężenia. Długość fali λmaxnλmaxn \lambda_{\text{max}}^{\text{n}} światła niebieskiego jest mniejsza niż λmaxczλmaxcz \lambda_{\text{max}}^{\text{cz}} światła czerwonego. Nawet nie znając dokładnych wartości, możemy znaleźć relację między odpowiadającymi im temperaturami.

Rozwiązanie

Stosując prawo Wiena dla niebieskiej i czerwonej gwiazdy, otrzymujemy
λ max cz T cz = 2,898 10 -3 m K = λ max n T n . λ max cz T cz = 2,898 10 -3 m K = λ max n T n . \lambda_{\text{max}}^{\text{cz}}T_{\text{cz}}=\SI{2,898e-3}{\metre\kelvin}=\lambda_{\text{max}}^{\text{n}}T_{\text{n}}\text{.}
6.2

Po uproszczeniu Równanie 6.2 daje nam

T cz = λ max n λ max cz T n < T n . T cz = λ max n λ max cz T n < T n . T_{\text{cz}}=\frac{\lambda_{\text{max}}^{\text{n}}}{\lambda_{\text{max}}^{\text{cz}}}T_{\text{n}}<T_{\text{n}}\text{.}
6.3

Wynika stąd, że Betelgeza jest zimniejsza niż Rigel.

Znaczenie

Zauważmy, że prawo Wiena mówi nam, iż wyższej temperaturze ciała emitującego promieniowanie odpowiada krótsza fala tego promieniowania. Jakościowa analiza zaprezentowana w tym przykładzie jest słuszna w odniesieniu do jakiegokolwiek ciała, niezależnie od tego, czy jest to olbrzymi obiekt, taki jak gwiazda, czy niewielki – taki jak włókno żarowe w żarówce.

Sprawdź, czy rozumiesz 6.1

Płomień świecy zapachowej ma kolor żółtawy, a płomień palnika Bunsena w laboratorium chemicznym ma kolor niebieskawy. Który płomień ma wyższą temperaturę?

 Zdjęcie po lewej stronie przedstawia gwiazdozbiór Oriona z czerwoną gwiazdą widoczną w lewym górnym rogu. Rysunek po prawej stronie przedstawia ten sam gwiazdozbiór w postaci starożytnego wojownika.
Ilustracja 6.5 W gwiazdozbiorze Oriona widoczna w lewym górnym rogu Betelgeza jest czerwonym nadolbrzymem, a widoczny w prawym dolnym rogu Rigel – błękitnym nadolbrzymem.

Kolejna zależność dotycząca promieniowania ciała doskonale czarnego to prawo Stefana-Boltzmanna (ang. Stefan-Boltzmann’s law). Dotyczy ono całkowitej mocy promieniowania wyemitowanego dla wszystkich długości fali przy danej temperaturze. Na wykresie z Ilustracji 6.3 całkowita moc odpowiada polu powierzchni pod krzywą. Całkowita moc promieniowania wzrasta wraz z temperaturą, co wyrażone jest w prawie Stefana-Boltzmanna w następujący sposób

P T = σ S T 4 , P T = σ S T 4 , P\apply(T)=\sigma ST^4\text{,}
6.4

gdzie SS S jest powierzchnią ciała doskonale czarnego, TT T jego temperaturą (w kelwinach), a σσ \sigma jest stałą Stefana-Boltzmanna (ang. Stefan-Boltzmann constant), σ=5,6710-8Wm2K4σ=5,6710-8Wm2K4 \DeclareSIPostPower{\super}{4} \sigma=\SI{5,67e-8}{\watt\per\metre\squared\per\kelvin\super}. Prawo Stefana-Boltzmanna pozwala nam oszacować, jak dużo energii wypromieniowuje gwiazda, poprzez pomiar jej temperatury (na przykład wykorzystujący prawo Wiena).

Przykład 6.2

Moc promieniowania gwiazd

Gwiazdy takie jak nasze Słońce ewoluują poprzez fazę czerwonych olbrzymów do fazy białych karłów. Typowy biały karzeł jest mniej więcej wielkości Ziemi, a temperatura jego powierzchni to w przybliżeniu 2,5104K2,5104K \SI{2,5e4}{\kelvin}. Temperatura powierzchni typowego czerwonego olbrzyma to 3103K3103K \SI{3e3}{\kelvin}, a jego promień jest około 100 000100 000 \num{100000} razy większy niż u białego karła. Jaka jest średnia moc promieniowania na jednostkę powierzchni i całkowita emitowana moc tego typu gwiazd? Jak mają się one do siebie?

Strategia rozwiązania

Wiedząc, że gwiazdę można traktować w przybliżeniu jak ciało doskonale czarne, możemy do opisu jej promieniowania zastosować prawo Stefana-Boltzmanna, mówiące o tym, że całkowita moc promieniowania proporcjonalna jest do czwartej potęgi temperatury. Aby wyznaczyć moc wypromieniowaną przez jednostkę powierzchni gwiazdy, nie musimy robić żadnych założeń co do jej kształtu, ponieważ PSPS P/S zależy tylko od temperatury. Jednak aby wyznaczyć całkowitą moc, musimy założyć, że energia wypromieniowana jest przez powierzchnię w kształcie sfery o polu S=4πR2S=4πR2 S=4\pi R^2, gdzie RR R jest jej promieniem.

Rozwiązanie

Możemy zapisać prostą proporcję, wynikającą z prawa Stefana-Boltzmanna (gdzie literami b.k. oznaczyliśmy wielkości odnoszące się do białego karła, a c.o. – do czerwonego olbrzyma)
P b.k. S b.k. P c.o. S c.o. = σ T b.k. 4 σ T c.o. 4 = T b.k. T c.o. 4 = 2,5 10 4 K 3 10 3 K 4 = 4820 . P b.k. S b.k. P c.o. S c.o. = σ T b.k. 4 σ T c.o. 4 = T b.k. T c.o. 4 = 2,5 10 4 K 3 10 3 K 4 = 4820 . \frac{P_{\text{b.k.}}/S_{\text{b.k.}}}{P_{\text{c.o.}}/S_{\text{c.o.}}}=\frac{\sigma T^4_{\text{b.k.}}}{\sigma T^4_{\text{c.o.}}}=(\frac{T_{\text{b.k.}}}{T_{\text{c.o.}}})^4=(\frac{\SI{2,5e4}{\kelvin}}{\SI{3e3}{\kelvin}})^4=\num{4820}\text{.}
6.5

Moc emitowana przez jednostkę powierzchni białego karła jest około 50005000 \num{5000} razy większa niż w przypadku czerwonego olbrzyma. Oznaczając ten stosunek przez α=4,82103α=4,82103 \alpha = \num{4,82e3}, ze wzoru (Równanie 6.5) otrzymujemy

P b.k. P c.o. = α S b.k. S c.o. = α 4 π R b.k. 2 4 π R c.o. 2 = α R b.k. R c.o. 2 P b.k. P c.o. = 4,82 10 3 R b.k. 10 5 R b.k. 2 = 4,82 10 -7 . P b.k. P c.o. = α S b.k. S c.o. = α 4 π R b.k. 2 4 π R c.o. 2 = α R b.k. R c.o. 2 P b.k. P c.o. = 4,82 10 3 R b.k. 10 5 R b.k. 2 = 4,82 10 -7 . \begin{multiline} \frac{P_{\text{b.k.}}}{P_{\text{c.o.}}}&=\alpha\frac{S_{\text{b.k.}}}{S_{\text{c.o.}}}=\alpha\frac{4\pi R^2_{\text{b.k.}}}{4\pi R^2_{\text{c.o.}}}=\alpha (\frac{R_{\text{b.k.}}}{R_{\text{c.o.}}})^2\\&=\num{4,82e3}\cdot (\frac{R_{\text{b.k.}}}{10^5R_{\text{b.k.}}})^2=\num{4,82e-7}\text{.} \end{multiline} P b.k. P c.o. = α S b.k. S c.o. = α 4 π R b.k. 2 4 π R c.o. 2 = α R b.k. R c.o. 2 = 4,82 10 3 R b.k. 10 5 R b.k. 2 = 4,82 10 -7 .
6.6

Widzimy, że całkowita moc promieniowania, emitowanego przez białego karła jest bardzo niewielka w porównaniu z mocą promieniowania emitowanego przez czerwonego olbrzyma. Mimo że temperatura czerwonego olbrzyma jest niższa, całkowita moc promieniowania jest dużo większa dzięki dużo większej powierzchni. Aby oszacować wartość mocy promieniowania na jednostkę powierzchni, skorzystamy ponownie z prawa Stefana-Boltzmanna. Dla białego karła otrzymujemy

P b.k. S b.k. = σ T b.k. 4 = 5,67 10 -8 W m 2 K 4 2,5 10 4 K 4 P b.k. S b.k. = 2,2 10 10 W m 2 . P b.k. S b.k. = σ T b.k. 4 = 5,67 10 -8 W m 2 K 4 2,5 10 4 K 4 P b.k. S b.k. = 2,2 10 10 W m 2 . \begin{multiline} \frac{P_{\text{b.k.}}}{S_{\text{b.k.}}} &=\sigma T^4_{\text{b.k.}}=\SI{5,67e-8}{\watt\per\meter\squared\per\kelvin\super}\cdot (\SI{2,5e4}{\kelvin})^4\\ &=\SI{2,2e10}{\watt\per\metre\squared}\text{.} \end{multiline} P b.k. S b.k. = σ T b.k. 4 = 5,67 10 -8 W m 2 K 4 2,5 10 4 K 4 = 2,2 10 10 W m 2 .
6.7

Wynik dla czerwonego olbrzyma uzyskamy, korzystając z poprzednio wyznaczonego stosunku

P c.o. S c.o. = 2,2 10 10 W m 2 4,82 10 3 = 4,56 10 6 W m 2 4,6 10 6 W m 2 . P c.o. S c.o. = 2,2 10 10 W m 2 4,82 10 3 = 4,56 10 6 W m 2 4,6 10 6 W m 2 . \frac{P_{\text{c.o.}}}{S_{\text{c.o.}}}=\frac{\num{2,2e10}\si{\watt\per\metre\squared}}{\num{4,82e3}}=\SI{4,56e6}{\watt\per\metre\squared} \cong \SI{4,6e6}{\watt\per\metre\squared}\text{.}
6.8

Znaczenie

Aby wyznaczyć całkowitą moc emitowaną przez gwiazdę, moglibyśmy użyć wzoru (Równanie 6.7). Jednak aby wyznaczyć potrzebne pole powierzchni, musielibyśmy znać promień tej gwiazdy, który w naszym przykładzie nie jest podany; zakończymy więc w tym miejscu nasze rozważania.

Sprawdź, czy rozumiesz 6.2

Rozgrzewamy żelazny pogrzebacz. Gdy jego temperatura wzrasta, pogrzebacz zaczyna świecić – najpierw jest ciemnoczerwony, z czasem staje się jasnoczerwony, pomarańczowy, a później żółty. Wyjaśnij, czemu tak się dzieje, korzystając z rozkładu spektralnego promieniowania ciała doskonale czarnego lub prawa Wiena.

Sprawdź, czy rozumiesz 6.3

Załóżmy, że dwie gwiazdy αα \alpha i ββ \beta, emitują promieniowanie o takiej samej mocy całkowitej. Jaki jest stosunek temperatur na ich powierzchni, jeśli promień gwiazdy αα \alpha jest trzy razy większy niż gwiazdy ββ \beta? Która gwiazda jest gorętsza?

Pojęcie „ciała doskonale czarnego” zostało po raz pierwszy użyte przez Gustava R. Kirchhoffa (1824–1887) w 1862 roku. Rozkład spektralny promieniowania (lub krzywa promieniowania) takiego ciała był znany eksperymentalnie, lecz wyjaśnienie jego kształtu nastąpiło dopiero w roku 1900. Próbując zrozumieć cechy promieniowania ciała doskonale czarnego o temperaturze TT T, posłużmy się modelem fizycznym w postaci fal elektromagnetycznych zamkniętych we wnęce (obejrzyj Ilustrację 6.2), znajdujących się w stanie równowagi termodynamicznej ze ściankami tej wnęki. Naszym celem jest znalezienie rozkładu gęstości energii niesionej przez fale o określonej długości. Gdy poznamy ten rozkład, będziemy mogli posłużyć się metodami statystycznymi (podobnymi do tych, z których korzystaliśmy w poprzednim rozdziale), aby otrzymać krzywą promieniowania cała doskonale czarnego, prawo Stefana-Boltzmanna oraz prawo przesunięć Wiena. Jeśli nasz model jest właściwy, uzyskane w ten sposób przewidywania powinny pokrywać się z danymi doświadczalnymi.

W klasycznym podejściu do problemu promieniowania ciała doskonale czarnego promieniowanie elektromagnetyczne traktuje się jak fale (tak jak to czyniliśmy w poprzednich rozdziałach). Mody fal elektromagnetycznych uwięzionych we wnęce znajdują się w stanie równowagi termodynamicznej i wymieniają energię ze ściankami wnęki. Dowolna ilość energii może być przekazana ściankom przez oddziałującą z nimi falę lub – w drugą stronę – fali przez ściankę. Taki klasyczny obraz stał się podstawą modelu rozwiniętego przez Lorda Rayleigha oraz, niezależnie, przez sir Jamesa Jeansa. Uzyskana przez nich postać rozkładów spektralnych promieniowania znana jest jako prawo Rayleigha–Jeansa. Jednak, jak widać na wykresie z Ilustracji 6.6, prawo to nie opisuje poprawnie wyników doświadczalnych. W granicy krótkich fal, w obszarze ultrafioletowym, prawo Rayleigha-Jeansa przewiduje nieskończone natężenie promieniowania, co w oczywisty sposób jest niezgodne z eksperymentem. Ta rozbieżność, nazywana katastrofą w ultrafiolecie (ang. ultraviolet catastrophe), dowodzi, że klasyczna fizyka nie jest w stanie opisać mechanizmu promieniowania ciała doskonale czarnego.

Wykres przedstawia zależność natężenia promieniowania od długości fali. Dane doświadczalne oznaczone są czerwonymi kropkami, pokazują wzrost wartości od długości fali ok. 1 mikrometra, aż do maksimum osiąganego około 2-3 mikrometrów, następnie spadek wartości praktycznie do zera dla fal o długości około 10mikrometrów. Krzywa Rayleigha—Jeansa przedstawiona jest obok danych doświadczalnych, zaczyna się u góry wykresu dla fal o długości około 5 i opada zbliżając się do danych doświadczalnych około 10 mikrometrów.
Ilustracja 6.6 Katastrofa w ultrafiolecie: prawo Rayleigha-Jeansa nie opisuje obserwowanego spektrum promieniowania ciała doskonale czarnego.

Problem promieniowania ciała doskonale czarnego został rozwiązany w roku 1900 przez Maxa Plancka (1858–1947). Podobnie jak Rayleigh-Jeans w swoim modelu, Planck rozważał klasycznie opisywane fale elektromagnetyczne w równowadze termodynamicznej ze ściankami wnęki. Nowością wprowadzoną przez Plancka było założenie, że źródłem promieniowania są drgania atomów w ściankach wnęki i że energia tych oscylacji może przybierać tylko dyskretne wartości. Wynika z tego, że promieniowanie może wymieniać energię ze ściankami wyłącznie w określonych „paczkach” energii. Hipoteza Plancka dotycząca dyskretnych wartości energii, które nazwał on kwantami, zakłada, że energia oscylatorów wewnątrz ścianek może przybierać wartości skwantowane (ang. quantized energies). Była to zupełnie nowa idea, wykraczająca poza klasyczną dziewiętnastowieczną fizykę, zgodnie z którą, jak nauczyłeś się w poprzednim rozdziale, energia oscylatora może mieć dowolną wartość. Planck założył, że energia oscylatora (EnEn E_n) może przybierać tylko dyskretne, skwantowane wartości

E n = n h ν , gdzie  n = 1 2 3 E n = n h ν , gdzie  n = 1 2 3 E_n = nh \nu\text{, gdzie }n=1,2,3,\dots
6.9

W Równaniu 6.9 νν \nu jest częstotliwością oscylatora. Liczba naturalna nn n, numerująca dyskretne stany energii, nazywana jest liczbą kwantową (ang. quantum number). Stała hh h nazywana jest stałą Plancka (ang. Planck’s constant)

h = 6,626 10 -34 J s = 4,136 10 -15 eV s . h = 6,626 10 -34 J s = 4,136 10 -15 eV s . h = \SI{6,626e-34}{\joule\second}=\SI{4,136e-15}{\electronvolt\second}\text{.}
6.10

Każda z dyskretnych wartości energii odpowiada stanowi kwantowemu oscylatora Plancka (ang. quantum state of a Planck’s oscillator). Stany kwantowe numerowane są liczbami kwantowymi. Przykładowo, gdy oscylator Plancka znajduje się w pierwszym (n=1n=1 n=1) stanie kwantowym, jego energia wynosi E1=hνE1=hν E_1=h\nu, gdy jest w stanie o n=2n=2 n=2, wartość jego energii wynosi E2=2hνE2=2hν E_2=2h\nu, gdy jest w stanie o liczbie kwantowej n=3n=3 n=3, to E3=3hνE3=3hν E_3=3h\nu i tak dalej.

Zauważmy, że z Równania 6.9 wynika, że jest nieskończenie wiele stanów kwantowych. Możemy je zapisać w postaci następującej sekwencji: {hν,2hν,3hν,,(n1)hν,nhν,(n+1)hν,}{hν,2hν,3hν,,(n1)hν,nhν,(n+1)hν,}. Kolejne stany kwantowe oddzielone są od siebie skokiem energii, ΔE=hνΔE=hν \prefop{\Delta}E=h\nu. Oscylator w ściance wnęki może odebrać energię od promieniowania wewnątrz wnęki (absorpcja) albo oddać energię promieniowaniu (emisja). Absorpcja powoduje, że oscylator przechodzi w wyższy stan kwantowy, emisja powoduje, że oscylator spada na niższy poziom. W którąkolwiek stronę zachodzi wymiana energii, najmniejsza ilość energii, która może być wymieniona, wynosi hνhν h\nu. Nie ma żadnego ograniczenia co do największej ilości wymienionej energii, ale wymiana musi być równa całkowitej wielokrotności hνhν h\nu.

Hipoteza Plancka kwantów energii

Hipoteza Plancka kwantów energii (ang. Planck’s hypothesis of energy quanta) zakłada, że ilość energii emitowanej przez oscylator unoszona jest przez kwant promieniowania, ΔEΔE \prefop{\Delta}E

Δ E = h ν . Δ E = h ν . \prefop{\Delta}E=h\nu\text{.}
6.11

Przypomnijmy, że częstotliwość promieniowania elektromagnetycznego związana jest z długością jego fali oraz z prędkością światła podstawowym wzorem νλ=cνλ=c \nu\lambda=c. Oznacza to, że możemy wyrazić Równanie 6.11 przez długość fali λλ \lambda. Gdy w wyprowadzeniu wzoru na gęstość energii promieniowania ciała doskonale czarnego skorzystamy z hipotezy Plancka, da nam to następującą zależność natężenia promieniowania na jednostkę długości fali

I λ T = 2 π h c 2 λ 5 1 e h c λ k B T 1 , I λ T = 2 π h c 2 λ 5 1 e h c λ k B T 1 , I\apply(\lambda, T)=\frac{2\pi hc^2}{\lambda^5}\cdot\frac{1}{e^{hc/(\lambda k_{\text{B}}T)}-1}\text{,}
6.12

gdzie cc c jest prędkością światła w próżni, kBkB k_{\text{B}} jest stałą Boltzmanna, kB=1,3810-23JKkB=1,3810-23JK k_{\text{B}}=\SI{1,38e-23}{\joule\per\kelvin}. Teoretyczne przewidywanie wyrażone wzorem (Równanie 6.12) nazywane jest prawem Plancka. Doskonale opisuje ono dane doświadczalne (spójrz na Ilustrację 6.7). Także prawo przesunięć Wiena oraz prawo Stefana-Boltzmanna wynikają wprost z Równania 6.12. Aby wyprowadzić prawo Wiena, należy użyć rachunku różniczkowego, aby znaleźć maksimum funkcji opisującej natężenie IλTIλT I\apply(\lambda, T). Prawo oraz wartość stałej Stefana-Boltzmanna wyprowadza się, całkując IλTIλT I\apply(\lambda, T), aby uzyskać całkowitą moc promieniowania emitowanego przez ciało doskonale czarne w zakresach fal od λ=0µmλ=0µm \lambda=\SI{0}{\micro\metre} do λλ \lambda \to \infty. Wyprowadzenie to będzie jednym z ćwiczeń w dalszej części rozdziału.

 Wykres przedstawia zależność natężenia promieniowania od długości fali. Dane doświadczalne oznaczone są czerwonymi kropkami, pokazują wzrost wartości od długości fali ok. 1 mikrometra, aż do maksimum osiąganego około 2-3 mikrometrów, następnie spadek wartości praktycznie do zera dla fal o długości około 10mikrometrów. Krzywa dana wzorem Plancka, idealnie przechodzi przez dane doświadczalne.
Ilustracja 6.7 Przewidywanie teoretyczne otrzymane przez Plancka (linia ciągła) i zmierzony rozkład spektralny promieniowania ciała doskonale czarnego (punkty).

Przykład 6.3

Kwantowy oscylator Plancka

Kwantowy oscylator w ścianie wnęki na Ilustracji 6.2 oscyluje z częstotliwością 51014Hz51014Hz \SI{5e14}{\hertz}. Wyznaczmy różnicę pomiędzy jego poziomami energetycznymi.

Strategia rozwiązania

Stany energetyczne oscylatora kwantowego dane są przez Równanie 6.9. Różnicę ΔEΔE \prefop{\Delta}E między energiami obliczamy, odejmując od siebie energie stanów o liczbach kwantowych n+1n+1 n + 1 oraz nn n.

Rozwiązanie

Możemy podstawić daną częstotliwość oraz stałą Plancka bezpośrednio do równania
Δ E = E n + 1 E n = n + 1 h ν n h ν = h ν = 6,626 10 -34 J s 5 10 14 Hz = 3,3 10 -19 J . Δ E = E n + 1 E n = n + 1 h ν n h ν = h ν = 6,626 10 -34 J s 5 10 14 Hz = 3,3 10 -19 J . \prefop{\Delta}E=E_{n+1}-E_n=(n+1)h\nu-nh\nu=h\nu=\SI{6,626e-34}{\joule\second}\cdot\SI{5e14}{\hertz}=\SI{3,3e-19}{\joule}\text{.}

Znaczenie

Warto zauważyć, że nie określaliśmy, z jakiego materiału zbudowana jest ściana wnęki. Oscylator kwantowy służył nam tutaj tyko jako teoretyczny model cząsteczki takiego materiału.

Sprawdź, czy rozumiesz 6.4

Cząsteczka oscyluje z częstotliwością 51014Hz51014Hz \SI{5e14}{\hertz}. Jaka jest najmniejsza odległość między jej wibracyjnymi poziomami energetycznymi?

Przykład 6.4

Teoria kwantowa zastosowana do makroskopowego oscylatora

Ciężarek o masie 1kg1kg \SI{1}{\kilogram} drga na końcu sprężyny o stałej sprężystości równej 1000Nm1000Nm \SI{1000}{\newton\per\metre}. Amplituda tych drgań wynosi 0,1m0,1m \SI{0,1}{\metre}. Jaka jest różnica między jego poziomami energetycznymi? Czy jest ona istotna dla makroskopowych systemów, takich jak rozważany oscylator?

Strategia rozwiązania

Skorzystamy ze wzoru opisującego kwantowy oscylator (Równanie 6.11), podstawiając częstotliwość νν \nu drgań ciężarka na sprężynie. Aby zbadać, jak istotny jest efekt kwantowania poziomów energetycznych, porównujemy przerwę między poziomami z całkowitą energią klasycznego oscylatora.

Rozwiązanie

Częstotliwość νν \nu drgań ciężarka o masie m=1kgm=1kg m=\SI{1}{\kilogram} na sprężynie o stałej sprężystości k=103Nmk=103Nm k=10^3\si{\newton\per\metre} wynosi
ν = 1 2 π k m = 1 2 π 10 3 N m 1 kg 5 Hz . ν = 1 2 π k m = 1 2 π 10 3 N m 1 kg 5 Hz . \nu = \frac{1}{2\pi}\sqrt{\frac{k}{m}}=\frac{1}{2\pi}\sqrt{\frac{10^3\si{\newton\per\metre}}{\SI{1}{\kilogram}}}\simeq\SI{5}{\hertz}\text{.}

Kwant energii odpowiadający tej częstotliwości jest równy

Δ E = h ν = 6,626 10 -34 J s 5 Hz = 3,3 10 -33 J . Δ E = h ν = 6,626 10 -34 J s 5 Hz = 3,3 10 -33 J . \prefop{\Delta}E=h\nu=\SI{6,626e-34}{\joule\second}\cdot\SI{5}{\hertz}=\SI{3,3e-33}{\joule}\text{.}

Energia drgań o amplitudzie A=0,1mA=0,1m A=\SI{0,1}{\metre} wynosi

E = 1 2 k A 2 = 1 2 1000 N m 0,1 m 2 = 5 J . E = 1 2 k A 2 = 1 2 1000 N m 0,1 m 2 = 5 J . E=\frac{1}{2}kA^2=\frac{1}{2}\cdot\SI{1000}{\newton\per\metre}\cdot(\SI{0,1}{\metre})^2=\SI{5}{\joule}\text{.}

Znaczenie

Widzimy więc, że w przypadku makroskopowego oscylatora mamy ΔEE10-34ΔEE10-34 \prefop{\Delta}E/E\approx 10^{-34}. Różnica poziomów energetycznych jest więc niemierzalnie mała i dla wszystkich praktycznych zastosowań można przyjąć, że energia makroskopowego oscylatora przyjmuje wartości ciągłe. Dlatego też układy makroskopowe można opisywać bez utraty dokładności, korzystając z praw fizyki klasycznej.

Sprawdź, czy rozumiesz 6.5

Czy wnioski byłyby inne niż w Przykładzie 6.4, gdyby masa wynosiła nie 1kg1kg \SI{1}{\kilogram}, tylko 1µg1µg \SI{1}{\micro\gram}, a amplituda drgań 0,1µm0,1µm \SI{0,1}{\micro\metre}?

Gdy Planck po raz pierwszy opublikował swoje wyniki, jego hipoteza kwantyzacji energii nie była traktowana poważnie, ponieważ nie wynikała z żadnej znanej wówczas teorii fizycznej. Była ona, nawet przez samego Plancka, odbierana raczej jako użyteczny matematyczny trik, prowadzący do dobrej teoretycznej parametryzacji danych doświadczalnych. Odbiór ten zmienił się w 1905 roku, po tym jak Einstein opublikował wyjaśnienie efektu fotoelektrycznego, w którym nadał kwantowi energii nowe znaczenie: cząstki światła.

Cytowanie i udostępnianie

Chcesz zacytować, udostępnić albo zmodyfikować treść tej książki? Została ona wydana na licencji Uznanie autorstwa (CC BY) , która wymaga od Ciebie uznania autorstwa OpenStax.

Cytowanie i udostępnienia
  • Jeśli rozpowszechniasz tę książkę w formie drukowanej, umieść na każdej jej kartce informację:
    Treści dostępne za darmo na https://openstax.org/books/fizyka-dla-szk%C3%B3%C5%82-wy%C5%BCszych-tom-3/pages/1-wstep
  • Jeśli rozpowszechniasz całą książkę lub jej fragment w formacie cyfrowym, na każdym widoku strony umieść informację:
    Treści dostępne za darmo na https://openstax.org/books/fizyka-dla-szk%C3%B3%C5%82-wy%C5%BCszych-tom-3/pages/1-wstep
Cytowanie

© 21 wrz 2022 OpenStax. Treść książki została wytworzona przez OpenStax na licencji Uznanie autorstwa (CC BY) . Nazwa OpenStax, logo OpenStax, okładki OpenStax, nazwa OpenStax CNX oraz OpenStax CNX logo nie podlegają licencji Creative Commons i wykorzystanie ich jest dozwolone wyłącznie na mocy uprzedniego pisemnego upoważnienia przez Rice University.