Skip to ContentGo to accessibility pageKeyboard shortcuts menu
OpenStax Logo
Organic Chemistry

27.1 Waxes, Fats, and Oils

Organic Chemistry27.1 Waxes, Fats, and Oils

Table of contents
  1. Dedication and Preface
  2. 1 Structure and Bonding
    1. Why This Chapter?
    2. 1.1 Atomic Structure: The Nucleus
    3. 1.2 Atomic Structure: Orbitals
    4. 1.3 Atomic Structure: Electron Configurations
    5. 1.4 Development of Chemical Bonding Theory
    6. 1.5 Describing Chemical Bonds: Valence Bond Theory
    7. 1.6 sp3 Hybrid Orbitals and the Structure of Methane
    8. 1.7 sp3 Hybrid Orbitals and the Structure of Ethane
    9. 1.8 sp2 Hybrid Orbitals and the Structure of Ethylene
    10. 1.9 sp Hybrid Orbitals and the Structure of Acetylene
    11. 1.10 Hybridization of Nitrogen, Oxygen, Phosphorus, and Sulfur
    12. 1.11 Describing Chemical Bonds: Molecular Orbital Theory
    13. 1.12 Drawing Chemical Structures
    14. Chemistry Matters—Organic Foods: Risk versus Benefit
    15. Key Terms
    16. Summary
    17. Additional Problems
  3. 2 Polar Covalent Bonds; Acids and Bases
    1. Why This Chapter?
    2. 2.1 Polar Covalent Bonds and Electronegativity
    3. 2.2 Polar Covalent Bonds and Dipole Moments
    4. 2.3 Formal Charges
    5. 2.4 Resonance
    6. 2.5 Rules for Resonance Forms
    7. 2.6 Drawing Resonance Forms
    8. 2.7 Acids and Bases: The Brønsted–Lowry Definition
    9. 2.8 Acid and Base Strength
    10. 2.9 Predicting Acid–Base Reactions from pKa Values
    11. 2.10 Organic Acids and Organic Bases
    12. 2.11 Acids and Bases: The Lewis Definition
    13. 2.12 Noncovalent Interactions between Molecules
    14. Chemistry Matters—Alkaloids: From Cocaine to Dental Anesthetics
    15. Key Terms
    16. Summary
    17. Additional Problems
  4. 3 Organic Compounds: Alkanes and Their Stereochemistry
    1. Why This Chapter?
    2. 3.1 Functional Groups
    3. 3.2 Alkanes and Alkane Isomers
    4. 3.3 Alkyl Groups
    5. 3.4 Naming Alkanes
    6. 3.5 Properties of Alkanes
    7. 3.6 Conformations of Ethane
    8. 3.7 Conformations of Other Alkanes
    9. Chemistry Matters—Gasoline
    10. Key Terms
    11. Summary
    12. Additional Problems
  5. 4 Organic Compounds: Cycloalkanes and Their Stereochemistry
    1. Why This Chapter?
    2. 4.1 Naming Cycloalkanes
    3. 4.2 Cis–Trans Isomerism in Cycloalkanes
    4. 4.3 Stability of Cycloalkanes: Ring Strain
    5. 4.4 Conformations of Cycloalkanes
    6. 4.5 Conformations of Cyclohexane
    7. 4.6 Axial and Equatorial Bonds in Cyclohexane
    8. 4.7 Conformations of Monosubstituted Cyclohexanes
    9. 4.8 Conformations of Disubstituted Cyclohexanes
    10. 4.9 Conformations of Polycyclic Molecules
    11. Chemistry Matters—Molecular Mechanics
    12. Key Terms
    13. Summary
    14. Additional Problems
  6. 5 Stereochemistry at Tetrahedral Centers
    1. Why This Chapter?
    2. 5.1 Enantiomers and the Tetrahedral Carbon
    3. 5.2 The Reason for Handedness in Molecules: Chirality
    4. 5.3 Optical Activity
    5. 5.4 Pasteur’s Discovery of Enantiomers
    6. 5.5 Sequence Rules for Specifying Configuration
    7. 5.6 Diastereomers
    8. 5.7 Meso Compounds
    9. 5.8 Racemic Mixtures and the Resolution of Enantiomers
    10. 5.9 A Review of Isomerism
    11. 5.10 Chirality at Nitrogen, Phosphorus, and Sulfur
    12. 5.11 Prochirality
    13. 5.12 Chirality in Nature and Chiral Environments
    14. Chemistry Matters—Chiral Drugs
    15. Key Terms
    16. Summary
    17. Additional Problems
  7. 6 An Overview of Organic Reactions
    1. Why This Chapter?
    2. 6.1 Kinds of Organic Reactions
    3. 6.2 How Organic Reactions Occur: Mechanisms
    4. 6.3 Polar Reactions
    5. 6.4 An Example of a Polar Reaction: Addition of HBr to Ethylene
    6. 6.5 Using Curved Arrows in Polar Reaction Mechanisms
    7. 6.6 Radical Reactions
    8. 6.7 Describing a Reaction: Equilibria, Rates, and Energy Changes
    9. 6.8 Describing a Reaction: Bond Dissociation Energies
    10. 6.9 Describing a Reaction: Energy Diagrams and Transition States
    11. 6.10 Describing a Reaction: Intermediates
    12. 6.11 A Comparison Between Biological Reactions and Laboratory Reactions
    13. Chemistry Matters—Where Do Drugs Come From?
    14. Key Terms
    15. Summary
    16. Additional Problems
  8. 7 Alkenes: Structure and Reactivity
    1. Why This Chapter?
    2. 7.1 Industrial Preparation and Use of Alkenes
    3. 7.2 Calculating the Degree of Unsaturation
    4. 7.3 Naming Alkenes
    5. 7.4 Cis–Trans Isomerism in Alkenes
    6. 7.5 Alkene Stereochemistry and the E,Z Designation
    7. 7.6 Stability of Alkenes
    8. 7.7 Electrophilic Addition Reactions of Alkenes
    9. 7.8 Orientation of Electrophilic Additions: Markovnikov’s Rule
    10. 7.9 Carbocation Structure and Stability
    11. 7.10 The Hammond Postulate
    12. 7.11 Evidence for the Mechanism of Electrophilic Additions: Carbocation Rearrangements
    13. Chemistry Matters—Bioprospecting: Hunting for Natural Products
    14. Key Terms
    15. Summary
    16. Additional Problems
  9. 8 Alkenes: Reactions and Synthesis
    1. Why This Chapter?
    2. 8.1 Preparing Alkenes: A Preview of Elimination Reactions
    3. 8.2 Halogenation of Alkenes: Addition of X2
    4. 8.3 Halohydrins from Alkenes: Addition of HO-X
    5. 8.4 Hydration of Alkenes: Addition of H2O by Oxymercuration
    6. 8.5 Hydration of Alkenes: Addition of H2O by Hydroboration
    7. 8.6 Reduction of Alkenes: Hydrogenation
    8. 8.7 Oxidation of Alkenes: Epoxidation and Hydroxylation
    9. 8.8 Oxidation of Alkenes: Cleavage to Carbonyl Compounds
    10. 8.9 Addition of Carbenes to Alkenes: Cyclopropane Synthesis
    11. 8.10 Radical Additions to Alkenes: Chain-Growth Polymers
    12. 8.11 Biological Additions of Radicals to Alkenes
    13. 8.12 Reaction Stereochemistry: Addition of H2O to an Achiral Alkene
    14. 8.13 Reaction Stereochemistry: Addition of H2O to a Chiral Alkene
    15. Chemistry Matters—Terpenes: Naturally Occurring Alkenes
    16. Key Terms
    17. Summary
    18. Summary of Reactions
    19. Additional Problems
  10. 9 Alkynes: An Introduction to Organic Synthesis
    1. Why This Chapter?
    2. 9.1 Naming Alkynes
    3. 9.2 Preparation of Alkynes: Elimination Reactions of Dihalides
    4. 9.3 Reactions of Alkynes: Addition of HX and X2
    5. 9.4 Hydration of Alkynes
    6. 9.5 Reduction of Alkynes
    7. 9.6 Oxidative Cleavage of Alkynes
    8. 9.7 Alkyne Acidity: Formation of Acetylide Anions
    9. 9.8 Alkylation of Acetylide Anions
    10. 9.9 An Introduction to Organic Synthesis
    11. Chemistry Matters—The Art of Organic Synthesis
    12. Key Terms
    13. Summary
    14. Summary of Reactions
    15. Additional Problems
  11. 10 Organohalides
    1. Why This Chapter?
    2. 10.1 Names and Structures of Alkyl Halides
    3. 10.2 Preparing Alkyl Halides from Alkanes: Radical Halogenation
    4. 10.3 Preparing Alkyl Halides from Alkenes: Allylic Bromination
    5. 10.4 Stability of the Allyl Radical: Resonance Revisited
    6. 10.5 Preparing Alkyl Halides from Alcohols
    7. 10.6 Reactions of Alkyl Halides: Grignard Reagents
    8. 10.7 Organometallic Coupling Reactions
    9. 10.8 Oxidation and Reduction in Organic Chemistry
    10. Chemistry Matters—Naturally Occurring Organohalides
    11. Key Terms
    12. Summary
    13. Summary of Reactions
    14. Additional Problems
  12. 11 Reactions of Alkyl Halides: Nucleophilic Substitutions and Eliminations
    1. Why This Chapter?
    2. 11.1 The Discovery of Nucleophilic Substitution Reactions
    3. 11.2 The SN2 Reaction
    4. 11.3 Characteristics of the SN2 Reaction
    5. 11.4 The SN1 Reaction
    6. 11.5 Characteristics of the SN1 Reaction
    7. 11.6 Biological Substitution Reactions
    8. 11.7 Elimination Reactions: Zaitsev’s Rule
    9. 11.8 The E2 Reaction and the Deuterium Isotope Effect
    10. 11.9 The E2 Reaction and Cyclohexane Conformation
    11. 11.10 The E1 and E1cB Reactions
    12. 11.11 Biological Elimination Reactions
    13. 11.12 A Summary of Reactivity: SN1, SN2, E1, E1cB, and E2
    14. Chemistry Matters—Green Chemistry
    15. Key Terms
    16. Summary
    17. Summary of Reactions
    18. Additional Problems
  13. 12 Structure Determination: Mass Spectrometry and Infrared Spectroscopy
    1. Why This Chapter?
    2. 12.1 Mass Spectrometry of Small Molecules: Magnetic-Sector Instruments
    3. 12.2 Interpreting Mass Spectra
    4. 12.3 Mass Spectrometry of Some Common Functional Groups
    5. 12.4 Mass Spectrometry in Biological Chemistry: Time-of-Flight (TOF) Instruments
    6. 12.5 Spectroscopy and the Electromagnetic Spectrum
    7. 12.6 Infrared Spectroscopy
    8. 12.7 Interpreting Infrared Spectra
    9. 12.8 Infrared Spectra of Some Common Functional Groups
    10. Chemistry Matters—X-Ray Crystallography
    11. Key Terms
    12. Summary
    13. Additional Problems
  14. 13 Structure Determination: Nuclear Magnetic Resonance Spectroscopy
    1. Why This Chapter?
    2. 13.1 Nuclear Magnetic Resonance Spectroscopy
    3. 13.2 The Nature of NMR Absorptions
    4. 13.3 Chemical Shifts
    5. 13.4 Chemical Shifts in 1H NMR Spectroscopy
    6. 13.5 Integration of 1H NMR Absorptions: Proton Counting
    7. 13.6 Spin–Spin Splitting in 1H NMR Spectra
    8. 13.7 1H NMR Spectroscopy and Proton Equivalence
    9. 13.8 More Complex Spin–Spin Splitting Patterns
    10. 13.9 Uses of 1H NMR Spectroscopy
    11. 13.10 13C NMR Spectroscopy: Signal Averaging and FT–NMR
    12. 13.11 Characteristics of 13C NMR Spectroscopy
    13. 13.12 DEPT 13C NMR Spectroscopy
    14. 13.13 Uses of 13C NMR Spectroscopy
    15. Chemistry Matters—Magnetic Resonance Imaging (MRI)
    16. Key Terms
    17. Summary
    18. Additional Problems
  15. 14 Conjugated Compounds and Ultraviolet Spectroscopy
    1. Why This Chapter?
    2. 14.1 Stability of Conjugated Dienes: Molecular Orbital Theory
    3. 14.2 Electrophilic Additions to Conjugated Dienes: Allylic Carbocations
    4. 14.3 Kinetic versus Thermodynamic Control of Reactions
    5. 14.4 The Diels–Alder Cycloaddition Reaction
    6. 14.5 Characteristics of the Diels–Alder Reaction
    7. 14.6 Diene Polymers: Natural and Synthetic Rubbers
    8. 14.7 Ultraviolet Spectroscopy
    9. 14.8 Interpreting Ultraviolet Spectra: The Effect of Conjugation
    10. 14.9 Conjugation, Color, and the Chemistry of Vision
    11. Chemistry Matters—Photolithography
    12. Key Terms
    13. Summary
    14. Summary of Reactions
    15. Additional Problems
  16. 15 Benzene and Aromaticity
    1. Why This Chapter?
    2. 15.1 Naming Aromatic Compounds
    3. 15.2 Structure and Stability of Benzene
    4. 15.3 Aromaticity and the Hückel 4n + 2 Rule
    5. 15.4 Aromatic Ions
    6. 15.5 Aromatic Heterocycles: Pyridine and Pyrrole
    7. 15.6 Polycyclic Aromatic Compounds
    8. 15.7 Spectroscopy of Aromatic Compounds
    9. Chemistry Matters—Aspirin, NSAIDs, and COX-2 Inhibitors
    10. Key Terms
    11. Summary
    12. Additional Problems
  17. 16 Chemistry of Benzene: Electrophilic Aromatic Substitution
    1. Why This Chapter?
    2. 16.1 Electrophilic Aromatic Substitution Reactions: Bromination
    3. 16.2 Other Aromatic Substitutions
    4. 16.3 Alkylation and Acylation of Aromatic Rings: The Friedel–Crafts Reaction
    5. 16.4 Substituent Effects in Electrophilic Substitutions
    6. 16.5 Trisubstituted Benzenes: Additivity of Effects
    7. 16.6 Nucleophilic Aromatic Substitution
    8. 16.7 Benzyne
    9. 16.8 Oxidation of Aromatic Compounds
    10. 16.9 Reduction of Aromatic Compounds
    11. 16.10 Synthesis of Polysubstituted Benzenes
    12. Chemistry Matters—Combinatorial Chemistry
    13. Key Terms
    14. Summary
    15. Summary of Reactions
    16. Additional Problems
  18. 17 Alcohols and Phenols
    1. Why This Chapter?
    2. 17.1 Naming Alcohols and Phenols
    3. 17.2 Properties of Alcohols and Phenols
    4. 17.3 Preparation of Alcohols: A Review
    5. 17.4 Alcohols from Carbonyl Compounds: Reduction
    6. 17.5 Alcohols from Carbonyl Compounds: Grignard Reaction
    7. 17.6 Reactions of Alcohols
    8. 17.7 Oxidation of Alcohols
    9. 17.8 Protection of Alcohols
    10. 17.9 Phenols and Their Uses
    11. 17.10 Reactions of Phenols
    12. 17.11 Spectroscopy of Alcohols and Phenols
    13. Chemistry Matters—Ethanol: Chemical, Drug, and Poison
    14. Key Terms
    15. Summary
    16. Summary of Reactions
    17. Additional Problems
  19. 18 Ethers and Epoxides; Thiols and Sulfides
    1. Why This Chapter?
    2. 18.1 Names and Properties of Ethers
    3. 18.2 Preparing Ethers
    4. 18.3 Reactions of Ethers: Acidic Cleavage
    5. 18.4 Cyclic Ethers: Epoxides
    6. 18.5 Reactions of Epoxides: Ring-Opening
    7. 18.6 Crown Ethers
    8. 18.7 Thiols and Sulfides
    9. 18.8 Spectroscopy of Ethers
    10. Chemistry Matters—Epoxy Resins and Adhesives
    11. Key Terms
    12. Summary
    13. Summary of Reactions
    14. Additional Problems
    15. Preview of Carbonyl Chemistry
  20. 19 Aldehydes and Ketones: Nucleophilic Addition Reactions
    1. Why This Chapter?
    2. 19.1 Naming Aldehydes and Ketones
    3. 19.2 Preparing Aldehydes and Ketones
    4. 19.3 Oxidation of Aldehydes and Ketones
    5. 19.4 Nucleophilic Addition Reactions of Aldehydes and Ketones
    6. 19.5 Nucleophilic Addition of H2O: Hydration
    7. 19.6 Nucleophilic Addition of HCN: Cyanohydrin Formation
    8. 19.7 Nucleophilic Addition of Hydride and Grignard Reagents: Alcohol Formation
    9. 19.8 Nucleophilic Addition of Amines: Imine and Enamine Formation
    10. 19.9 Nucleophilic Addition of Hydrazine: The Wolff–Kishner Reaction
    11. 19.10 Nucleophilic Addition of Alcohols: Acetal Formation
    12. 19.11 Nucleophilic Addition of Phosphorus Ylides: The Wittig Reaction
    13. 19.12 Biological Reductions
    14. 19.13 Conjugate Nucleophilic Addition to α,β‑Unsaturated Aldehydes and Ketones
    15. 19.14 Spectroscopy of Aldehydes and Ketones
    16. Chemistry Matters—Enantioselective Synthesis
    17. Key Terms
    18. Summary
    19. Summary of Reactions
    20. Additional Problems
  21. 20 Carboxylic Acids and Nitriles
    1. Why This Chapter?
    2. 20.1 Naming Carboxylic Acids and Nitriles
    3. 20.2 Structure and Properties of Carboxylic Acids
    4. 20.3 Biological Acids and the Henderson–Hasselbalch Equation
    5. 20.4 Substituent Effects on Acidity
    6. 20.5 Preparing Carboxylic Acids
    7. 20.6 Reactions of Carboxylic Acids: An Overview
    8. 20.7 Chemistry of Nitriles
    9. 20.8 Spectroscopy of Carboxylic Acids and Nitriles
    10. Chemistry Matters—Vitamin C
    11. Key Terms
    12. Summary
    13. Summary of Reactions
    14. Additional Problems
  22. 21 Carboxylic Acid Derivatives: Nucleophilic Acyl Substitution Reactions
    1. Why This Chapter?
    2. 21.1 Naming Carboxylic Acid Derivatives
    3. 21.2 Nucleophilic Acyl Substitution Reactions
    4. 21.3 Reactions of Carboxylic Acids
    5. 21.4 Chemistry of Acid Halides
    6. 21.5 Chemistry of Acid Anhydrides
    7. 21.6 Chemistry of Esters
    8. 21.7 Chemistry of Amides
    9. 21.8 Chemistry of Thioesters and Acyl Phosphates: Biological Carboxylic Acid Derivatives
    10. 21.9 Polyamides and Polyesters: Step-Growth Polymers
    11. 21.10 Spectroscopy of Carboxylic Acid Derivatives
    12. Chemistry Matters—β-Lactam Antibiotics
    13. Key Terms
    14. Summary
    15. Summary of Reactions
    16. Additional Problems
  23. 22 Carbonyl Alpha-Substitution Reactions
    1. Why This Chapter?
    2. 22.1 Keto–Enol Tautomerism
    3. 22.2 Reactivity of Enols: α-Substitution Reactions
    4. 22.3 Alpha Halogenation of Aldehydes and Ketones
    5. 22.4 Alpha Bromination of Carboxylic Acids
    6. 22.5 Acidity of Alpha Hydrogen Atoms: Enolate Ion Formation
    7. 22.6 Reactivity of Enolate Ions
    8. 22.7 Alkylation of Enolate Ions
    9. Chemistry Matters—Barbiturates
    10. Key Terms
    11. Summary
    12. Summary of Reactions
    13. Additional Problems
  24. 23 Carbonyl Condensation Reactions
    1. Why This Chapter?
    2. 23.1 Carbonyl Condensations: The Aldol Reaction
    3. 23.2 Carbonyl Condensations versus Alpha Substitutions
    4. 23.3 Dehydration of Aldol Products: Synthesis of Enones
    5. 23.4 Using Aldol Reactions in Synthesis
    6. 23.5 Mixed Aldol Reactions
    7. 23.6 Intramolecular Aldol Reactions
    8. 23.7 The Claisen Condensation Reaction
    9. 23.8 Mixed Claisen Condensations
    10. 23.9 Intramolecular Claisen Condensations: The Dieckmann Cyclization
    11. 23.10 Conjugate Carbonyl Additions: The Michael Reaction
    12. 23.11 Carbonyl Condensations with Enamines: The Stork Enamine Reaction
    13. 23.12 The Robinson Annulation Reaction
    14. 23.13 Some Biological Carbonyl Condensation Reactions
    15. Chemistry Matters—A Prologue to Metabolism
    16. Key Terms
    17. Summary
    18. Summary of Reactions
    19. Additional Problems
  25. 24 Amines and Heterocycles
    1. Why This Chapter?
    2. 24.1 Naming Amines
    3. 24.2 Structure and Properties of Amines
    4. 24.3 Basicity of Amines
    5. 24.4 Basicity of Arylamines
    6. 24.5 Biological Amines and the Henderson–Hasselbalch Equation
    7. 24.6 Synthesis of Amines
    8. 24.7 Reactions of Amines
    9. 24.8 Reactions of Arylamines
    10. 24.9 Heterocyclic Amines
    11. 24.10 Spectroscopy of Amines
    12. Chemistry Matters—Green Chemistry II: Ionic Liquids
    13. Key Terms
    14. Summary
    15. Summary of Reactions
    16. Additional Problems
  26. 25 Biomolecules: Carbohydrates
    1. Why This Chapter?
    2. 25.1 Classification of Carbohydrates
    3. 25.2 Representing Carbohydrate Stereochemistry: Fischer Projections
    4. 25.3 D,L Sugars
    5. 25.4 Configurations of the Aldoses
    6. 25.5 Cyclic Structures of Monosaccharides: Anomers
    7. 25.6 Reactions of Monosaccharides
    8. 25.7 The Eight Essential Monosaccharides
    9. 25.8 Disaccharides
    10. 25.9 Polysaccharides and Their Synthesis
    11. 25.10 Some Other Important Carbohydrates
    12. Chemistry Matters—Sweetness
    13. Key Terms
    14. Summary
    15. Summary of Reactions
    16. Additional Problems
  27. 26 Biomolecules: Amino Acids, Peptides, and Proteins
    1. Why This Chapter?
    2. 26.1 Structures of Amino Acids
    3. 26.2 Amino Acids and the Henderson–Hasselbalch Equation: Isoelectric Points
    4. 26.3 Synthesis of Amino Acids
    5. 26.4 Peptides and Proteins
    6. 26.5 Amino Acid Analysis of Peptides
    7. 26.6 Peptide Sequencing: The Edman Degradation
    8. 26.7 Peptide Synthesis
    9. 26.8 Automated Peptide Synthesis: The Merrifield Solid-Phase Method
    10. 26.9 Protein Structure
    11. 26.10 Enzymes and Coenzymes
    12. 26.11 How Do Enzymes Work? Citrate Synthase
    13. Chemistry Matters—The Protein Data Bank
    14. Key Terms
    15. Summary
    16. Summary of Reactions
    17. Additional Problems
  28. 27 Biomolecules: Lipids
    1. Why This Chapter?
    2. 27.1 Waxes, Fats, and Oils
    3. 27.2 Soap
    4. 27.3 Phospholipids
    5. 27.4 Prostaglandins and Other Eicosanoids
    6. 27.5 Terpenoids
    7. 27.6 Steroids
    8. 27.7 Biosynthesis of Steroids
    9. Chemistry Matters—Saturated Fats, Cholesterol, and Heart Disease
    10. Key Terms
    11. Summary
    12. Additional Problems
  29. 28 Biomolecules: Nucleic Acids
    1. Why This Chapter?
    2. 28.1 Nucleotides and Nucleic Acids
    3. 28.2 Base Pairing in DNA
    4. 28.3 Replication of DNA
    5. 28.4 Transcription of DNA
    6. 28.5 Translation of RNA: Protein Biosynthesis
    7. 28.6 DNA Sequencing
    8. 28.7 DNA Synthesis
    9. 28.8 The Polymerase Chain Reaction
    10. Chemistry Matters—DNA Fingerprinting
    11. Key Terms
    12. Summary
    13. Additional Problems
  30. 29 The Organic Chemistry of Metabolic Pathways
    1. Why This Chapter?
    2. 29.1 An Overview of Metabolism and Biochemical Energy
    3. 29.2 Catabolism of Triacylglycerols: The Fate of Glycerol
    4. 29.3 Catabolism of Triacylglycerols: β-Oxidation
    5. 29.4 Biosynthesis of Fatty Acids
    6. 29.5 Catabolism of Carbohydrates: Glycolysis
    7. 29.6 Conversion of Pyruvate to Acetyl CoA
    8. 29.7 The Citric Acid Cycle
    9. 29.8 Carbohydrate Biosynthesis: Gluconeogenesis
    10. 29.9 Catabolism of Proteins: Deamination
    11. 29.10 Some Conclusions about Biological Chemistry
    12. Chemistry Matters—Statin Drugs
    13. Key Terms
    14. Summary
    15. Additional Problems
  31. 30 Orbitals and Organic Chemistry: Pericyclic Reactions
    1. Why This Chapter?
    2. 30.1 Molecular Orbitals of Conjugated Pi Systems
    3. 30.2 Electrocyclic Reactions
    4. 30.3 Stereochemistry of Thermal Electrocyclic Reactions
    5. 30.4 Photochemical Electrocyclic Reactions
    6. 30.5 Cycloaddition Reactions
    7. 30.6 Stereochemistry of Cycloadditions
    8. 30.7 Sigmatropic Rearrangements
    9. 30.8 Some Examples of Sigmatropic Rearrangements
    10. 30.9 A Summary of Rules for Pericyclic Reactions
    11. Chemistry Matters—Vitamin D, the Sunshine Vitamin
    12. Key Terms
    13. Summary
    14. Additional Problems
  32. 31 Synthetic Polymers
    1. Why This Chapter?
    2. 31.1 Chain-Growth Polymers
    3. 31.2 Stereochemistry of Polymerization: Ziegler–Natta Catalysts
    4. 31.3 Copolymers
    5. 31.4 Step-Growth Polymers
    6. 31.5 Olefin Metathesis Polymerization
    7. 31.6 Intramolecular Olefin Metathesis
    8. 31.7 Polymer Structure and Physical Properties
    9. Chemistry Matters—Degradable Polymers
    10. Key Terms
    11. Summary
    12. Additional Problems
  33. A | Nomenclature of Polyfunctional Organic Compounds
  34. B | Acidity Constants for Some Organic Compounds
  35. C | Glossary
  36. D | Periodic Table
  37. Answer Key
    1. Chapter 1
    2. Chapter 2
    3. Chapter 3
    4. Chapter 4
    5. Chapter 5
    6. Chapter 6
    7. Chapter 7
    8. Chapter 8
    9. Chapter 9
    10. Chapter 10
    11. Chapter 11
    12. Chapter 12
    13. Chapter 13
    14. Chapter 14
    15. Chapter 15
    16. Chapter 16
    17. Chapter 17
    18. Chapter 18
    19. Chapter 19
    20. Chapter 20
    21. Chapter 21
    22. Chapter 22
    23. Chapter 23
    24. Chapter 24
    25. Chapter 25
    26. Chapter 26
    27. Chapter 27
    28. Chapter 28
    29. Chapter 29
    30. Chapter 30
    31. Chapter 31
  38. Index

27.1 • Waxes, Fats, and Oils

Waxes are mixtures of esters of long-chain carboxylic acids with long-chain alcohols. The carboxylic acid usually has an even number of carbons from 16 to 36, while the alcohol has an even number of carbons from 24 to 36. One of the major components of beeswax, for instance, is triacontyl hexadecanoate, the ester of the C30 alcohol (1-triacontanol) and the C16 acid (hexadecanoic acid). The waxy protective coatings on most fruits, berries, leaves, and animal furs have similar structures.

The ball-and-stick model of beeswax. The structure of triacontyl hexadecanoate is the major constituent of beeswax.

Animal fats and vegetable oils are the most widely occurring lipids. Although they appear different—animal fats like butter and lard are solids, whereas vegetable oils like corn and peanut oil are liquid—their structures are closely related. Chemically, fats and oils are triglycerides, or triacylglycerols—triesters of glycerol with three long-chain carboxylic acids called fatty acids. Animals use fats for long-term energy storage because they are far less highly oxidized than carbohydrates and provide about six times as much energy as an equal weight of stored, hydrated glycogen.

The structure of a triacylglycerol comprises stearoyl (stearic acid), oleoyl (oleic acid), and linoleoyl (linoleic acid). The glycerol and fatty acyl groups are labeled in the structure.

Hydrolysis of a fat or oil with aqueous NaOH yields glycerol and three fatty acids. The fatty acids are generally unbranched and contain an even number of carbon atoms between 12 and 20. If double bonds are present, they have mostly, although not entirely, Z, or cis, geometry. The three fatty acids of a specific triacylglycerol molecule need not be the same, and the fat or oil from a given source is likely to be a complex mixture of many different triacylglycerols. Table 27.1 lists some of the commonly occurring fatty acids, and Table 27.2 lists the approximate composition of fats and oils from different sources.

Table 27.1 Structures of Some Common Fatty Acids
Name No. of carbons Melting point (°C) Structure
Saturated
Lauric 12 43.2 CH3(CH2)10CO2H
Myristic 14 53.9 CH3(CH2)12CO2H
Palmitic 16 63.1 CH3(CH2)14CO2H
Stearic 18 68.8 CH3(CH2)16CO2H
Arachidic 20 76.5 CH3(CH2)18CO2H
Unsaturated
Palmitoleic 16 –0.1 (Z)-CH3(CH2)5CH═CH(CH2)7CO2H(Z)-CH3(CH2)5CH═CH(CH2)7CO2H
Oleic 18 13.4 (Z)-CH3(CH2)7CH═CH(CH2)7CO2H(Z)-CH3(CH2)7CH═CH(CH2)7CO2H
Linoleic 18 –12   (Z,Z)-CH3(CH2)4(CH═CHCH2)2(CH2)6CO2H(Z,Z)-CH3(CH2)4(CH═CHCH2)2(CH2)6CO2H
Linolenic 18 –11   (all Z)-CH3CH2(CH═CHCH2)3(CH2)6CO2H(all Z)-CH3CH2(CH═CHCH2)3(CH2)6CO2H
Arachidonic 20 –49.5 (all Z)-CH3(CH2)4(CH═CHCH2)4CH2CH2CO2H(all Z)-CH3(CH2)4(CH═CHCH2)4CH2CH2CO2H
Table 27.2 Composition of Some Fats and Oils
  Saturated fatty acids (%) Unsaturated fatty acids (%)
Source C12 lauric C14 myristic C16 palmitic C18 stearic C18 oleic C18 linoleic
Animal fat
Lard  1 25 15 50  6
Butter  2 10 25 10 25  5
Human fat  1  3 25  8 46 10
Whale blubber  8 12  3 35 10
Vegetable oil
Coconut 50 18  8  2  6  1
Corn  1 10  4 35 45
Olive  1  5  5 80  7
Peanut  7  5 60 20

More than 100 different fatty acids are known and about 40 occur widely. Palmitic acid (C16) and stearic acid (C18) are the most abundant saturated fatty acids; oleic and linoleic acids (both C18) are the most abundant unsaturated ones. Oleic acid is monounsaturated because it has only one double bond, whereas linoleic, linolenic, and arachidonic acids are polyunsaturated fatty acids because they have more than one double bond. Linoleic and linolenic acids occur in cream and are essential in the human diet; infants grow poorly and develop skin lesions if fed a diet of nonfat milk for prolonged periods. Linolenic acid, in particular, is an example of an omega-3 fatty acid, which has been found to lower blood triglyceride levels and reduce the risk of heart attack. The name omega-3 means that there is a double bond three carbons in from the noncarboxyl end of the chain.

The ball-and-stick model and structure of stearic acid. It is an eighteen-carbon chain with a carboxylic acid group. Black, gray, and red spheres denote carbon, hydrogen, and oxygen, respectively.
A ball-and-stick model of linolenic acid. It is an eighteen-carbon chain with double bond and carboxylic acid group. Black, gray, and red spheres denote carbon, hydrogen, and oxygen, respectively.

The data in Table 27.1 show that unsaturated fatty acids generally have lower melting points than their saturated counterparts, a trend that is also true for triacylglycerols. Since vegetable oils generally have a higher proportion of unsaturated to saturated fatty acids than animal fats (Table 27.2), they have lower melting points. The difference is a consequence of structure. Saturated fats have a uniform shape that allows them to pack together efficiently in a crystal lattice. In unsaturated vegetable oils, however, the CCCC bonds introduce bends and kinks into the hydrocarbon chains, making crystal formation more difficult. The more double bonds there are, the harder it is for the molecules to crystallize and the lower the melting point of the oil.

The CCCC bonds in vegetable oils can be reduced by catalytic hydrogenation, typically carried out at high temperature using a nickel catalyst, to produce saturated solid or semisolid fats. Prior to 2015, industrially produced margarine and shortening were produced by hydrogenating soybean, peanut, or cottonseed oil until the proper consistency is obtained. As of 2015, trans fats are no longer considered safe by the FDA and have since been phased out of industrially produced foods. Unfortunately, the hydrogenation reaction is accompanied by some cis–trans isomerization of the remaining double bonds, producing fats with about 10% to 15% trans unsaturated fatty acids. Dietary intake of trans fatty acids increases cholesterol levels in the blood, thereby increasing the risk of heart problems. The conversion of linoleic acid into elaidic acid is an example.

Linoleic acid reacts with hydrogen in the presence of catalyst to form elaidic acid. The double bond is in cis position for the reactant and trans position for the product.
Problem 27-1
Carnauba wax, used in floor and furniture polishes, contains an ester of a C32 straight-chain alcohol with a C20 straight-chain carboxylic acid. Draw its structure.
Problem 27-2
Draw structures of glyceryl tripalmitate and glyceryl trioleate. Which would you expect to have a higher melting point?
Citation/Attribution

Want to cite, share, or modify this book? This book uses the Creative Commons Attribution-NonCommercial-ShareAlike License and you must attribute OpenStax.

Attribution information
  • If you are redistributing all or part of this book in a print format, then you must include on every physical page the following attribution:
    Access for free at https://openstax.org/books/organic-chemistry/pages/1-why-this-chapter
  • If you are redistributing all or part of this book in a digital format, then you must include on every digital page view the following attribution:
    Access for free at https://openstax.org/books/organic-chemistry/pages/1-why-this-chapter
Citation information

© Sep 25, 2023 OpenStax. Textbook content produced by OpenStax is licensed under a Creative Commons Attribution-NonCommercial-ShareAlike License . The OpenStax name, OpenStax logo, OpenStax book covers, OpenStax CNX name, and OpenStax CNX logo are not subject to the Creative Commons license and may not be reproduced without the prior and express written consent of Rice University.