Skip to ContentGo to accessibility page
OpenStax Logo
Chemistry: Atoms First


Chemistry: Atoms FirstExercises
  1. Preface
  2. 1 Essential Ideas
    1. Introduction
    2. 1.1 Chemistry in Context
    3. 1.2 Phases and Classification of Matter
    4. 1.3 Physical and Chemical Properties
    5. 1.4 Measurements
    6. 1.5 Measurement Uncertainty, Accuracy, and Precision
    7. 1.6 Mathematical Treatment of Measurement Results
    8. Key Terms
    9. Key Equations
    10. Summary
    11. Exercises
  3. 2 Atoms, Molecules, and Ions
    1. Introduction
    2. 2.1 Early Ideas in Atomic Theory
    3. 2.2 Evolution of Atomic Theory
    4. 2.3 Atomic Structure and Symbolism
    5. 2.4 Chemical Formulas
    6. Key Terms
    7. Key Equations
    8. Summary
    9. Exercises
  4. 3 Electronic Structure and Periodic Properties of Elements
    1. Introduction
    2. 3.1 Electromagnetic Energy
    3. 3.2 The Bohr Model
    4. 3.3 Development of Quantum Theory
    5. 3.4 Electronic Structure of Atoms (Electron Configurations)
    6. 3.5 Periodic Variations in Element Properties
    7. 3.6 The Periodic Table
    8. 3.7 Molecular and Ionic Compounds
    9. Key Terms
    10. Key Equations
    11. Summary
    12. Exercises
  5. 4 Chemical Bonding and Molecular Geometry
    1. Introduction
    2. 4.1 Ionic Bonding
    3. 4.2 Covalent Bonding
    4. 4.3 Chemical Nomenclature
    5. 4.4 Lewis Symbols and Structures
    6. 4.5 Formal Charges and Resonance
    7. 4.6 Molecular Structure and Polarity
    8. Key Terms
    9. Key Equations
    10. Summary
    11. Exercises
  6. 5 Advanced Theories of Bonding
    1. Introduction
    2. 5.1 Valence Bond Theory
    3. 5.2 Hybrid Atomic Orbitals
    4. 5.3 Multiple Bonds
    5. 5.4 Molecular Orbital Theory
    6. Key Terms
    7. Key Equations
    8. Summary
    9. Exercises
  7. 6 Composition of Substances and Solutions
    1. Introduction
    2. 6.1 Formula Mass
    3. 6.2 Determining Empirical and Molecular Formulas
    4. 6.3 Molarity
    5. 6.4 Other Units for Solution Concentrations
    6. Key Terms
    7. Key Equations
    8. Summary
    9. Exercises
  8. 7 Stoichiometry of Chemical Reactions
    1. Introduction
    2. 7.1 Writing and Balancing Chemical Equations
    3. 7.2 Classifying Chemical Reactions
    4. 7.3 Reaction Stoichiometry
    5. 7.4 Reaction Yields
    6. 7.5 Quantitative Chemical Analysis
    7. Key Terms
    8. Key Equations
    9. Summary
    10. Exercises
  9. 8 Gases
    1. Introduction
    2. 8.1 Gas Pressure
    3. 8.2 Relating Pressure, Volume, Amount, and Temperature: The Ideal Gas Law
    4. 8.3 Stoichiometry of Gaseous Substances, Mixtures, and Reactions
    5. 8.4 Effusion and Diffusion of Gases
    6. 8.5 The Kinetic-Molecular Theory
    7. 8.6 Non-Ideal Gas Behavior
    8. Key Terms
    9. Key Equations
    10. Summary
    11. Exercises
  10. 9 Thermochemistry
    1. Introduction
    2. 9.1 Energy Basics
    3. 9.2 Calorimetry
    4. 9.3 Enthalpy
    5. 9.4 Strengths of Ionic and Covalent Bonds
    6. Key Terms
    7. Key Equations
    8. Summary
    9. Exercises
  11. 10 Liquids and Solids
    1. Introduction
    2. 10.1 Intermolecular Forces
    3. 10.2 Properties of Liquids
    4. 10.3 Phase Transitions
    5. 10.4 Phase Diagrams
    6. 10.5 The Solid State of Matter
    7. 10.6 Lattice Structures in Crystalline Solids
    8. Key Terms
    9. Key Equations
    10. Summary
    11. Exercises
  12. 11 Solutions and Colloids
    1. Introduction
    2. 11.1 The Dissolution Process
    3. 11.2 Electrolytes
    4. 11.3 Solubility
    5. 11.4 Colligative Properties
    6. 11.5 Colloids
    7. Key Terms
    8. Key Equations
    9. Summary
    10. Exercises
  13. 12 Thermodynamics
    1. Introduction
    2. 12.1 Spontaneity
    3. 12.2 Entropy
    4. 12.3 The Second and Third Laws of Thermodynamics
    5. 12.4 Free Energy
    6. Key Terms
    7. Key Equations
    8. Summary
    9. Exercises
  14. 13 Fundamental Equilibrium Concepts
    1. Introduction
    2. 13.1 Chemical Equilibria
    3. 13.2 Equilibrium Constants
    4. 13.3 Shifting Equilibria: Le Châtelier’s Principle
    5. 13.4 Equilibrium Calculations
    6. Key Terms
    7. Key Equations
    8. Summary
    9. Exercises
  15. 14 Acid-Base Equilibria
    1. Introduction
    2. 14.1 Brønsted-Lowry Acids and Bases
    3. 14.2 pH and pOH
    4. 14.3 Relative Strengths of Acids and Bases
    5. 14.4 Hydrolysis of Salt Solutions
    6. 14.5 Polyprotic Acids
    7. 14.6 Buffers
    8. 14.7 Acid-Base Titrations
    9. Key Terms
    10. Key Equations
    11. Summary
    12. Exercises
  16. 15 Equilibria of Other Reaction Classes
    1. Introduction
    2. 15.1 Precipitation and Dissolution
    3. 15.2 Lewis Acids and Bases
    4. 15.3 Multiple Equilibria
    5. Key Terms
    6. Key Equations
    7. Summary
    8. Exercises
  17. 16 Electrochemistry
    1. Introduction
    2. 16.1 Balancing Oxidation-Reduction Reactions
    3. 16.2 Galvanic Cells
    4. 16.3 Standard Reduction Potentials
    5. 16.4 The Nernst Equation
    6. 16.5 Batteries and Fuel Cells
    7. 16.6 Corrosion
    8. 16.7 Electrolysis
    9. Key Terms
    10. Key Equations
    11. Summary
    12. Exercises
  18. 17 Kinetics
    1. Introduction
    2. 17.1 Chemical Reaction Rates
    3. 17.2 Factors Affecting Reaction Rates
    4. 17.3 Rate Laws
    5. 17.4 Integrated Rate Laws
    6. 17.5 Collision Theory
    7. 17.6 Reaction Mechanisms
    8. 17.7 Catalysis
    9. Key Terms
    10. Key Equations
    11. Summary
    12. Exercises
  19. 18 Representative Metals, Metalloids, and Nonmetals
    1. Introduction
    2. 18.1 Periodicity
    3. 18.2 Occurrence and Preparation of the Representative Metals
    4. 18.3 Structure and General Properties of the Metalloids
    5. 18.4 Structure and General Properties of the Nonmetals
    6. 18.5 Occurrence, Preparation, and Compounds of Hydrogen
    7. 18.6 Occurrence, Preparation, and Properties of Carbonates
    8. 18.7 Occurrence, Preparation, and Properties of Nitrogen
    9. 18.8 Occurrence, Preparation, and Properties of Phosphorus
    10. 18.9 Occurrence, Preparation, and Compounds of Oxygen
    11. 18.10 Occurrence, Preparation, and Properties of Sulfur
    12. 18.11 Occurrence, Preparation, and Properties of Halogens
    13. 18.12 Occurrence, Preparation, and Properties of the Noble Gases
    14. Key Terms
    15. Summary
    16. Exercises
  20. 19 Transition Metals and Coordination Chemistry
    1. Introduction
    2. 19.1 Occurrence, Preparation, and Properties of Transition Metals and Their Compounds
    3. 19.2 Coordination Chemistry of Transition Metals
    4. 19.3 Spectroscopic and Magnetic Properties of Coordination Compounds
    5. Key Terms
    6. Summary
    7. Exercises
  21. 20 Nuclear Chemistry
    1. Introduction
    2. 20.1 Nuclear Structure and Stability
    3. 20.2 Nuclear Equations
    4. 20.3 Radioactive Decay
    5. 20.4 Transmutation and Nuclear Energy
    6. 20.5 Uses of Radioisotopes
    7. 20.6 Biological Effects of Radiation
    8. Key Terms
    9. Key Equations
    10. Summary
    11. Exercises
  22. 21 Organic Chemistry
    1. Introduction
    2. 21.1 Hydrocarbons
    3. 21.2 Alcohols and Ethers
    4. 21.3 Aldehydes, Ketones, Carboxylic Acids, and Esters
    5. 21.4 Amines and Amides
    6. Key Terms
    7. Summary
    8. Exercises
  23. A | The Periodic Table
  24. B | Essential Mathematics
  25. C | Units and Conversion Factors
  26. D | Fundamental Physical Constants
  27. E | Water Properties
  28. F | Composition of Commercial Acids and Bases
  29. G | Standard Thermodynamic Properties for Selected Substances
  30. H | Ionization Constants of Weak Acids
  31. I | Ionization Constants of Weak Bases
  32. J | Solubility Products
  33. K | Formation Constants for Complex Ions
  34. L | Standard Electrode (Half-Cell) Potentials
  35. M | Half-Lives for Several Radioactive Isotopes
  36. Answer Key
    1. Chapter 1
    2. Chapter 2
    3. Chapter 3
    4. Chapter 4
    5. Chapter 5
    6. Chapter 6
    7. Chapter 7
    8. Chapter 8
    9. Chapter 9
    10. Chapter 10
    11. Chapter 11
    12. Chapter 12
    13. Chapter 13
    14. Chapter 14
    15. Chapter 15
    16. Chapter 16
    17. Chapter 17
    18. Chapter 18
    19. Chapter 19
    20. Chapter 20
    21. Chapter 21
  37. Index

13.1 Chemical Equilibria


What does it mean to describe a reaction as “reversible”?


When writing an equation, how is a reversible reaction distinguished from a nonreversible reaction?


If a reaction is reversible, when can it be said to have reached equilibrium?


Is a system at equilibrium if the rate constants of the forward and reverse reactions are equal?


If the concentrations of products and reactants are equal, is the system at equilibrium?

13.2 Equilibrium Constants


Explain why there may be an infinite number of values for the reaction quotient of a reaction at a given temperature but there can be only one value for the equilibrium constant at that temperature.


Explain why an equilibrium between Br2(l) and Br2(g) would not be established if the container were not a closed vessel shown in Figure 13.5.


If you observe the following reaction at equilibrium, is it possible to tell whether the reaction started with pure NO2 or with pure N2O4?


Among the solubility rules previously discussed is the statement: All chlorides are soluble except Hg2Cl2, AgCl, PbCl2, and CuCl.

(a) Write the expression for the equilibrium constant for the reaction represented by the equation AgCl(s)Ag+(aq)+Cl(aq).AgCl(s)Ag+(aq)+Cl(aq). Is Kc > 1, < 1, or ≈ 1? Explain your answer.

(b) Write the expression for the equilibrium constant for the reaction represented by the equation Pb2+(aq)+2Cl(aq)PbCl2(s).Pb2+(aq)+2Cl(aq)PbCl2(s). Is Kc > 1, < 1, or ≈ 1? Explain your answer.


Among the solubility rules previously discussed is the statement: Carbonates, phosphates, borates, and arsenates—except those of the ammonium ion and the alkali metals—are insoluble.

(a) Write the expression for the equilibrium constant for the reaction represented by the equation CaCO3(s)Ca2+(aq)+CO32−(aq).CaCO3(s)Ca2+(aq)+CO32−(aq). Is Kc > 1, < 1, or ≈ 1? Explain your answer.

(b) Write the expression for the equilibrium constant for the reaction represented by the equation 3Ba2+(aq)+2PO43−(aq)Ba3(PO4)2(s).3Ba2+(aq)+2PO43−(aq)Ba3(PO4)2(s). Is Kc > 1, < 1, or ≈ 1? Explain your answer.


Benzene is one of the compounds used as octane enhancers in unleaded gasoline. It is manufactured by the catalytic conversion of acetylene to benzene: 3C2H2(g)C6H6(g).3C2H2(g)C6H6(g). Which value of Kc would make this reaction most useful commercially? Kc ≈ 0.01, Kc ≈ 1, or Kc ≈ 10. Explain your answer.


Show that the complete chemical equation, the total ionic equation, and the net ionic equation for the reaction represented by the equation KI(aq)+I2(aq)KI3(aq)KI(aq)+I2(aq)KI3(aq) give the same expression for the reaction quotient. KI3 is composed of the ions K+ and I3.I3.


For a titration to be effective, the reaction must be rapid and the yield of the reaction must essentially be 100%. Is Kc > 1, < 1, or ≈ 1 for a titration reaction?


For a precipitation reaction to be useful in a gravimetric analysis, the product of the reaction must be insoluble. Is Kc > 1, < 1, or ≈ 1 for a useful precipitation reaction?


Write the mathematical expression for the reaction quotient, Qc, for each of the following reactions:

(a) CH4(g)+Cl2(g)CH3Cl(g)+HCl(g)CH4(g)+Cl2(g)CH3Cl(g)+HCl(g)

(b) N2(g)+O2(g)2NO(g)N2(g)+O2(g)2NO(g)

(c) 2SO2(g)+O2(g)2SO3(g)2SO2(g)+O2(g)2SO3(g)

(d) BaSO3(s)BaO(s)+SO2(g)BaSO3(s)BaO(s)+SO2(g)

(e) P4(g)+5O2(g)P4O10(s)P4(g)+5O2(g)P4O10(s)

(f) Br2(g)2Br(g)Br2(g)2Br(g)

(g) CH4(g)+2O2(g)CO2(g)+2H2O(l)CH4(g)+2O2(g)CO2(g)+2H2O(l)

(h) CuSO4·5H2O(s)CuSO4(s)+5H2O(g)CuSO4·5H2O(s)CuSO4(s)+5H2O(g)


Write the mathematical expression for the reaction quotient, Qc, for each of the following reactions:

(a) N2(g)+3H2(g)2NH3(g)N2(g)+3H2(g)2NH3(g)

(b) 4NH3(g)+5O2(g)4NO(g)+6H2O(g)4NH3(g)+5O2(g)4NO(g)+6H2O(g)

(c) N2O4(g)2NO2(g)N2O4(g)2NO2(g)

(d) CO2(g)+H2(g)CO(g)+H2O(g)CO2(g)+H2(g)CO(g)+H2O(g)

(e) NH4Cl(s)NH3(g)+HCl(g)NH4Cl(s)NH3(g)+HCl(g)

(f) 2Pb(NO3)2(s)2PbO(s)+4NO2(g)+O2(g)2Pb(NO3)2(s)2PbO(s)+4NO2(g)+O2(g)

(g) 2H2(g)+O2(g)2H2O(l)2H2(g)+O2(g)2H2O(l)

(h) S8(g)8S(g)S8(g)8S(g)


The initial concentrations or pressures of reactants and products are given for each of the following systems. Calculate the reaction quotient and determine the direction in which each system will proceed to reach equilibrium.

(a) 2NH3(g)N2(g)+3H2(g)Kc=17;2NH3(g)N2(g)+3H2(g)Kc=17; [NH3] = 0.20 M, [N2] = 1.00 M, [H2] = 1.00 M

(b) 2NH3(g)N2(g)+3H2(g)KP=6.8×104;2NH3(g)N2(g)+3H2(g)KP=6.8×104; initial pressures: NH3 = 3.0 atm, N2 = 2.0 atm, H2 = 1.0 atm

(c) 2SO3(g)2SO2(g)+O2(g)Kc=0.230;2SO3(g)2SO2(g)+O2(g)Kc=0.230; [SO3] = 0.00 M, [SO2] = 1.00 M, [O2] = 1.00 M

(d) 2SO3(g)2SO2(g)+O2(g)KP=16.5;2SO3(g)2SO2(g)+O2(g)KP=16.5; initial pressures: SO3 = 1.00 atm, SO2 = 1.00 atm, O2 = 1.00 atm

(e) 2NO(g)+Cl2(g)2NOCl(g)Kc=4.6×104;2NO(g)+Cl2(g)2NOCl(g)Kc=4.6×104; [NO] = 1.00 M, [Cl2] = 1.00 M, [NOCl] = 0 M

(f) N2(g)+O2(g)2NO(g)KP=0.050;N2(g)+O2(g)2NO(g)KP=0.050; initial pressures: NO = 10.0 atm, N2 = O2 = 5 atm


The initial concentrations or pressures of reactants and products are given for each of the following systems. Calculate the reaction quotient and determine the direction in which each system will proceed to reach equilibrium.

(a) 2NH3(g)N2(g)+3H2(g)Kc=17;2NH3(g)N2(g)+3H2(g)Kc=17; [NH3] = 0.50 M, [N2] = 0.15 M, [H2] = 0.12 M

(b) 2NH3(g)N2(g)+3H2(g)KP=6.8×104;2NH3(g)N2(g)+3H2(g)KP=6.8×104; initial pressures: NH3 = 2.00 atm, N2 = 10.00 atm, H2 = 10.00 atm

(c) 2SO3(g)2SO2(g)+O2(g)Kc=0.230;2SO3(g)2SO2(g)+O2(g)Kc=0.230; [SO3] = 2.00 M, [SO2] = 2.00 M, [O2] = 2.00 M

(d) 2SO3(g)2SO2(g)+O2(g)KP=6.5atm;2SO3(g)2SO2(g)+O2(g)KP=6.5atm; initial pressures: SO2 = 1.00 atm, O2 = 1.130 atm, SO3 = 0 atm

(e) 2NO(g)+Cl2(g)2NOCl(g)KP=2.5×103;2NO(g)+Cl2(g)2NOCl(g)KP=2.5×103; initial pressures: NO = 1.00 atm, Cl2 = 1.00 atm, NOCl = 0 atm

(f) N2(g)+O2(g)2NO(g)Kc=0.050;N2(g)+O2(g)2NO(g)Kc=0.050; [N2] = 0.100 M, [O2] = 0.200 M, [NO] = 1.00 M


The following reaction has KP = 4.50 ×× 10−5 at 720 K.

If a reaction vessel is filled with each gas to the partial pressures listed, in which direction will it shift to reach equilibrium? P(NH3) = 93 atm, P(N2) = 48 atm, and P(H2) = 52


Determine if the following system is at equilibrium. If not, in which direction will the system need to shift to reach equilibrium?

[SO2Cl2] = 0.12 M, [Cl2] = 0.16 M and [SO2] = 0.050 M. Kc for the reaction is 0.078.


Which of the systems described in Exercise 13.15 give homogeneous equilibria? Which give heterogeneous equilibria?


Which of the systems described in Exercise 13.16 give homogeneous equilibria? Which give heterogeneous equilibria?


For which of the reactions in Exercise 13.15 does Kc (calculated using concentrations) equal KP (calculated using pressures)?


For which of the reactions in Exercise 13.16 does Kc (calculated using concentrations) equal KP (calculated using pressures)?


Convert the values of Kc to values of KP or the values of KP to values of Kc.

(a) N2(g)+3H2(g)2NH3(g)Kc=0.50at400°CN2(g)+3H2(g)2NH3(g)Kc=0.50at400°C

(b) H2(g)+I2(g)2HI(g)Kc=50.2at448°CH2(g)+I2(g)2HI(g)Kc=50.2at448°C

(c) Na2SO4·10H2O(s)Na2SO4(s)+10H2O(g)KP=4.08×10−25at25°CNa2SO4·10H2O(s)Na2SO4(s)+10H2O(g)KP=4.08×10−25at25°C

(d) H2O(l)H2O(g)KP=0.122at50°CH2O(l)H2O(g)KP=0.122at50°C


Convert the values of Kc to values of KP or the values of KP to values of Kc.

(a) Cl2(g)+Br2(g)2BrCl(g)Kc=4.7×10−2at25°CCl2(g)+Br2(g)2BrCl(g)Kc=4.7×10−2at25°C

(b) 2SO2(g)+O2(g)2SO3(g)KP=48.2at500°C2SO2(g)+O2(g)2SO3(g)KP=48.2at500°C

(c) CaCl2·6H2O(s)CaCl2(s)+6H2O(g)KP=5.09×10−44at25°CCaCl2·6H2O(s)CaCl2(s)+6H2O(g)KP=5.09×10−44at25°C

(d) H2O(l)H2O(g)KP=0.196at60°CH2O(l)H2O(g)KP=0.196at60°C


What is the value of the equilibrium constant expression for the change H2O(l)H2O(g)H2O(l)H2O(g) at 30 °C? (See Appendix E.)


Write the expression of the reaction quotient for the ionization of HOCN in water.


Write the reaction quotient expression for the ionization of NH3 in water.


What is the approximate value of the equilibrium constant KP for the change C2H5OC2H5(l)C2H5OC2H5(g)C2H5OC2H5(l)C2H5OC2H5(g) at 25 °C. (Vapor pressure was described in the previous chapter on liquids and solids; refer back to this chapter to find the relevant information needed to solve this problem.)

13.3 Shifting Equilibria: Le Châtelier’s Principle


The following equation represents a reversible decomposition:

Under what conditions will decomposition in a closed container proceed to completion so that no CaCO3 remains?


Explain how to recognize the conditions under which changes in pressure would affect systems at equilibrium.


What property of a reaction can we use to predict the effect of a change in temperature on the value of an equilibrium constant?


What would happen to the color of the solution in part (b) of Figure 13.8 if a small amount of NaOH were added and Fe(OH)3 precipitated? Explain your answer.


The following reaction occurs when a burner on a gas stove is lit:

Is an equilibrium among CH4, O2, CO2, and H2O established under these conditions? Explain your answer.


A necessary step in the manufacture of sulfuric acid is the formation of sulfur trioxide, SO3, from sulfur dioxide, SO2, and oxygen, O2, shown here. At high temperatures, the rate of formation of SO3 is higher, but the equilibrium amount (concentration or partial pressure) of SO3 is lower than it would be at lower temperatures.

(a) Does the equilibrium constant for the reaction increase, decrease, or remain about the same as the temperature increases?

(b) Is the reaction endothermic or exothermic?


Suggest four ways in which the concentration of hydrazine, N2H4, could be increased in an equilibrium described by the following equation:


Suggest four ways in which the concentration of PH3 could be increased in an equilibrium described by the following equation:


How will an increase in temperature affect each of the following equilibria? How will a decrease in the volume of the reaction vessel affect each?

(a) 2NH3(g)N2(g)+3H2(g)ΔH=92kJ2NH3(g)N2(g)+3H2(g)ΔH=92kJ

(b) N2(g)+O2(g)2NO(g)ΔH=181kJN2(g)+O2(g)2NO(g)ΔH=181kJ

(c) 2O3(g)3O2(g)ΔH=−285kJ2O3(g)3O2(g)ΔH=−285kJ

(d) CaO(s)+CO2(g)CaCO3(s)ΔH=−176kJCaO(s)+CO2(g)CaCO3(s)ΔH=−176kJ


How will an increase in temperature affect each of the following equilibria? How will a decrease in the volume of the reaction vessel affect each?

(a) 2H2O(g)2H2(g)+O2(g)ΔH=484kJ2H2O(g)2H2(g)+O2(g)ΔH=484kJ

(b) N2(g)+3H2(g)2NH3(g)ΔH=−92.2kJN2(g)+3H2(g)2NH3(g)ΔH=−92.2kJ

(c) 2Br(g)Br2(g)ΔH=−224kJ2Br(g)Br2(g)ΔH=−224kJ

(d) H2(g)+I2(s)2HI(g)ΔH=53kJH2(g)+I2(s)2HI(g)ΔH=53kJ


Water gas is a 1:1 mixture of carbon monoxide and hydrogen gas and is called water gas because it is formed from steam and hot carbon in the following reaction: H2O(g)+C(s)H2(g)+CO(g).H2O(g)+C(s)H2(g)+CO(g). Methanol, a liquid fuel that could possibly replace gasoline, can be prepared from water gas and hydrogen at high temperature and pressure in the presence of a suitable catalyst.

(a) Write the expression for the equilibrium constant (Kc) for the reversible reaction

(b) What will happen to the concentrations of H2, CO, and CH3OH at equilibrium if more H2 is added?

(c) What will happen to the concentrations of H2, CO, and CH3OH at equilibrium if CO is removed?

(d) What will happen to the concentrations of H2, CO, and CH3OH at equilibrium if CH3OH is added?

(e) What will happen to the concentrations of H2, CO, and CH3OH at equilibrium if the temperature of the system is increased?


Nitrogen and oxygen react at high temperatures.

(a) Write the expression for the equilibrium constant (Kc) for the reversible reaction

(b) What will happen to the concentrations of N2, O2, and NO at equilibrium if more O2 is added?

(c) What will happen to the concentrations of N2, O2, and NO at equilibrium if N2 is removed?

(d) What will happen to the concentrations of N2, O2, and NO at equilibrium if NO is added?

(e) What will happen to the concentrations of N2, O2, and NO at equilibrium if the pressure on the system is increased by reducing the volume of the reaction vessel?

(f) What will happen to the concentrations of N2, O2, and NO at equilibrium if the temperature of the system is increased?


Water gas, a mixture of H2 and CO, is an important industrial fuel produced by the reaction of steam with red hot coke, essentially pure carbon.

(a) Write the expression for the equilibrium constant for the reversible reaction

(b) What will happen to the concentration of each reactant and product at equilibrium if more C is added?

(c) What will happen to the concentration of each reactant and product at equilibrium if H2O is removed?

(d) What will happen to the concentration of each reactant and product at equilibrium if CO is added?

(e) What will happen to the concentration of each reactant and product at equilibrium if the temperature of the system is increased?


Pure iron metal can be produced by the reduction of iron(III) oxide with hydrogen gas.

(a) Write the expression for the equilibrium constant (Kc) for the reversible reaction

(b) What will happen to the concentration of each reactant and product at equilibrium if more Fe is added?

(c) What will happen to the concentration of each reactant and product at equilibrium if H2O is removed?

(d) What will happen to the concentration of each reactant and product at equilibrium if H2 is added?

(e) What will happen to the concentration of each reactant and product at equilibrium if the pressure on the system is increased by reducing the volume of the reaction vessel?

(f) What will happen to the concentration of each reactant and product at equilibrium if the temperature of the system is increased?


Ammonia is a weak base that reacts with water according to this equation:

Will any of the following increase the percent of ammonia that is converted to the ammonium ion in water?

(a) Addition of NaOH

(b) Addition of HCl

(c) Addition of NH4Cl


Acetic acid is a weak acid that reacts with water according to this equation:

Will any of the following increase the percent of acetic acid that reacts and produces CH3CO2CH3CO2 ion?

(a) Addition of HCl

(b) Addition of NaOH

(c) Addition of NaCH3CO2


Suggest two ways in which the equilibrium concentration of Ag+ can be reduced in a solution of Na+, Cl, Ag+, and NO3,NO3, in contact with solid AgCl.


How can the pressure of water vapor be increased in the following equilibrium?


Additional solid silver sulfate, a slightly soluble solid, is added to a solution of silver ion and sulfate ion at equilibrium with solid silver sulfate.

Which of the following will occur?

(a) Ag+ or SO42−SO42− concentrations will not change.

(b) The added silver sulfate will dissolve.

(c) Additional silver sulfate will form and precipitate from solution as Ag+ ions and SO42−SO42− ions combine.

(d) The Ag+ ion concentration will increase and the SO42−SO42− ion concentration will decrease.


The amino acid alanine has two isomers, α-alanine and β-alanine. When equal masses of these two compounds are dissolved in equal amounts of a solvent, the solution of α-alanine freezes at the lowest temperature. Which form, α-alanine or β-alanine, has the larger equilibrium constant for ionization (HXH++X)(HXH++X)?

13.4 Equilibrium Calculations


A reaction is represented by this equation: A(aq)+2B(aq)2C(aq)Kc=1×103A(aq)+2B(aq)2C(aq)Kc=1×103

(a) Write the mathematical expression for the equilibrium constant.

(b) Using concentrations ≤1 M, make up two sets of concentrations that describe a mixture of A, B, and C at equilibrium.


A reaction is represented by this equation: 2W(aq)X(aq)+2Y(aq)Kc=5×10−42W(aq)X(aq)+2Y(aq)Kc=5×10−4

(a) Write the mathematical expression for the equilibrium constant.

(b) Using concentrations of ≤1 M, make up two sets of concentrations that describe a mixture of W, X, and Y at equilibrium.


What is the value of the equilibrium constant at 500 °C for the formation of NH3 according to the following equation?


An equilibrium mixture of NH3(g), H2(g), and N2(g) at 500 °C was found to contain 1.35 M H2, 1.15 M N2, and 4.12 ×× 10−1 M NH3.


Hydrogen is prepared commercially by the reaction of methane and water vapor at elevated temperatures.


What is the equilibrium constant for the reaction if a mixture at equilibrium contains gases with the following concentrations: CH4, 0.126 M; H2O, 0.242 M; CO, 0.126 M; H2 1.15 M, at a temperature of 760 °C?


A 0.72-mol sample of PCl5 is put into a 1.00-L vessel and heated. At equilibrium, the vessel contains 0.40 mol of PCl3(g) and 0.40 mol of Cl2(g). Calculate the value of the equilibrium constant for the decomposition of PCl5 to PCl3 and Cl2 at this temperature.


At 1 atm and 25 °C, NO2 with an initial concentration of 1.00 M is 3.3 ×× 10−3% decomposed into NO and O2. Calculate the value of the equilibrium constant for the reaction.



Calculate the value of the equilibrium constant KP for the reaction 2NO(g)+Cl2(g)2NOCl(g)2NO(g)+Cl2(g)2NOCl(g) from these equilibrium pressures: NO, 0.050 atm; Cl2, 0.30 atm; NOCl, 1.2 atm.


When heated, iodine vapor dissociates according to this equation:


At 1274 K, a sample exhibits a partial pressure of I2 of 0.1122 atm and a partial pressure due to I atoms of 0.1378 atm. Determine the value of the equilibrium constant, KP, for the decomposition at 1274 K.


A sample of ammonium chloride was heated in a closed container.


At equilibrium, the pressure of NH3(g) was found to be 1.75 atm. What is the value of the equilibrium constant KP for the decomposition at this temperature?


At a temperature of 60 °C, the vapor pressure of water is 0.196 atm. What is the value of the equilibrium constant KP for the transformation at 60 °C?



Complete the changes in concentrations (or pressure, if requested) for each of the following reactions.





(c) Change in pressure:


(d) Change in pressure:




(f) change in pressure:



Complete the changes in concentrations (or pressure, if requested) for each of the following reactions.





(c) Change in pressure:


(d) Change in pressure:




(f) Change in pressure:



Why are there no changes specified for Ni in Exercise 13.61, part (f)? What property of Ni does change?


Why are there no changes specified for NH4HS in Exercise 13.62, part (e)? What property of NH4HS does change?


Analysis of the gases in a sealed reaction vessel containing NH3, N2, and H2 at equilibrium at 400 °C established the concentration of N2 to be 1.2 M and the concentration of H2 to be 0.24 M.


Calculate the equilibrium molar concentration of NH3.


Calculate the number of moles of HI that are at equilibrium with 1.25 mol of H2 and 1.25 mol of I2 in a 5.00−L flask at 448 °C.



What is the pressure of BrCl in an equilibrium mixture of Cl2, Br2, and BrCl if the pressure of Cl2 in the mixture is 0.115 atm and the pressure of Br2 in the mixture is 0.450 atm?



What is the pressure of CO2 in a mixture at equilibrium that contains 0.50 atm H2, 2.0 atm of H2O, and 1.0 atm of CO at 990 °C?



Cobalt metal can be prepared by reducing cobalt(II) oxide with carbon monoxide.


What concentration of CO remains in an equilibrium mixture with [CO2] = 0.100 M?


Carbon reacts with water vapor at elevated temperatures.


What is the concentration of CO in an equilibrium mixture with [H2O] = 0.500 M at 1000 °C?


Sodium sulfate 10−hydrate, Na2SO4·10H2O, dehydrates according to the equation


What is the pressure of water vapor at equilibrium with a mixture of Na2SO4·10H2O and NaSO4?


Calcium chloride 6−hydrate, CaCl2·6H2O, dehydrates according to the equation


What is the pressure of water vapor at equilibrium with a mixture of CaCl2·6H2O and CaCl2?


A student solved the following problem and found the equilibrium concentrations to be [SO2] = 0.590 M, [O2] = 0.0450 M, and [SO3] = 0.260 M. How could this student check the work without reworking the problem? The problem was: For the following reaction at 600 °C:



A student solved the following problem and found [N2O4] = 0.16 M at equilibrium. How could this student recognize that the answer was wrong without reworking the problem? The problem was: What is the equilibrium concentration of N2O4 in a mixture formed from a sample of NO2 with a concentration of 0.10 M?



Assume that the change in concentration of N2O4 is small enough to be neglected in the following problem.

(a) Calculate the equilibrium concentration of both species in 1.00 L of a solution prepared from 0.129 mol of N2O4 with chloroform as the solvent.

N2O4(g)2NO2(g)Kc=1.07×10−5N2O4(g)2NO2(g)Kc=1.07×10−5 in chloroform

(b) Show that the change is small enough to be neglected.


Assume that the change in concentration of COCl2 is small enough to be neglected in the following problem.

(a) Calculate the equilibrium concentration of all species in an equilibrium mixture that results from the decomposition of COCl2 with an initial concentration of 0.3166 M.


(b) Show that the change is small enough to be neglected.


Assume that the change in pressure of H2S is small enough to be neglected in the following problem.

(a) Calculate the equilibrium pressures of all species in an equilibrium mixture that results from the decomposition of H2S with an initial pressure of 0.824 atm.


(b) Show that the change is small enough to be neglected.


What are all concentrations after a mixture that contains [H2O] = 1.00 M and [Cl2O] = 1.00 M comes to equilibrium at 25 °C?



What are the concentrations of PCl5, PCl3, and Cl2 in an equilibrium mixture produced by the decomposition of a sample of pure PCl5 with [PCl5] = 2.00 M?



Calculate the pressures of all species at equilibrium in a mixture of NOCl, NO, and Cl2 produced when a sample of NOCl with a pressure of 10.0 atm comes to equilibrium according to this reaction:


Calculate the equilibrium concentrations of NO, O2, and NO2 in a mixture at 250 °C that results from the reaction of 0.20 M NO and 0.10 M O2. (Hint: K is large; assume the reaction goes to completion then comes back to equilibrium.)



Calculate the equilibrium concentrations that result when 0.25 M O2 and 1.0 M HCl react and come to equilibrium.



One of the important reactions in the formation of smog is represented by the equation


What is the pressure of O3 remaining after a mixture of O3 with a pressure of 1.2 ×× 10−8 atm and NO with a pressure of 1.2 ×× 10−8 atm comes to equilibrium? (Hint: KP is large; assume the reaction goes to completion then comes back to equilibrium.)


Calculate the pressures of NO, Cl2, and NOCl in an equilibrium mixture produced by the reaction of a starting mixture with 4.0 atm NO and 2.0 atm Cl2. (Hint: KP is small; assume the reverse reaction goes to completion then comes back to equilibrium.)



Calculate the number of grams of HI that are at equilibrium with 1.25 mol of H2 and 63.5 g of iodine at 448 °C.



Butane exists as two isomers, n−butane and isobutane.

Three Lewis structures are shown. The first is labeled, “n dash Butane,” and has a C H subscript 3 single bonded to a C H subscript 2 group. This C H subscript 2 group is single bonded to another C H subscript 2 group which is single bonded to a C H subscript 3 group. The second is labeled, “iso dash Butane,” and is composed of a C H group single bonded to three C H subscript 3 groups. The third structure shows a chain of atoms: “C H subscript 3, C H subscript 2, C H subscript 2, C H subscript 3,” a double-headed arrow, then a carbon atom single bonded to three C H subscript 3 groups as well as a hydrogen atom.

KP = 2.5 at 25 °C

What is the pressure of isobutane in a container of the two isomers at equilibrium with a total pressure of 1.22 atm?


What is the minimum mass of CaCO3 required to establish equilibrium at a certain temperature in a 6.50-L container if the equilibrium constant (Kc) is 0.050 for the decomposition reaction of CaCO3 at that temperature?



The equilibrium constant (Kc) for this reaction is 1.60 at 990 °C:


Calculate the number of moles of each component in the final equilibrium mixture obtained from adding 1.00 mol of H2, 2.00 mol of CO2, 0.750 mol of H2O, and 1.00 mol of CO to a 5.00-L container at 990 °C.


At 25 °C and at 1 atm, the partial pressures in an equilibrium mixture of N2O4 and NO2 are PN2O4=0.70atmPN2O4=0.70atm and PNO2=0.30atm.PNO2=0.30atm.

(a) Predict how the pressures of NO2 and N2O4 will change if the total pressure increases to 9.0 atm. Will they increase, decrease, or remain the same?

(b) Calculate the partial pressures of NO2 and N2O4 when they are at equilibrium at 9.0 atm and 25 °C.


In a 3.0-L vessel, the following equilibrium partial pressures are measured: N2, 190 torr; H2, 317 torr; NH3, 1.00 ×× 103 torr.


(a) How will the partial pressures of H2, N2, and NH3 change if H2 is removed from the system? Will they increase, decrease, or remain the same?

(b) Hydrogen is removed from the vessel until the partial pressure of nitrogen, at equilibrium, is 250 torr. Calculate the partial pressures of the other substances under the new conditions.


The equilibrium constant (Kc) for this reaction is 5.0 at a given temperature.


(a) On analysis, an equilibrium mixture of the substances present at the given temperature was found to contain 0.20 mol of CO, 0.30 mol of water vapor, and 0.90 mol of H2 in a liter. How many moles of CO2 were there in the equilibrium mixture?

(b) Maintaining the same temperature, additional H2 was added to the system, and some water vapor was removed by drying. A new equilibrium mixture was thereby established containing 0.40 mol of CO, 0.30 mol of water vapor, and 1.2 mol of H2 in a liter. How many moles of CO2 were in the new equilibrium mixture? Compare this with the quantity in part (a), and discuss whether the second value is reasonable. Explain how it is possible for the water vapor concentration to be the same in the two equilibrium solutions even though some vapor was removed before the second equilibrium was established.


Antimony pentachloride decomposes according to this equation:


An equilibrium mixture in a 5.00-L flask at 448 °C contains 3.85 g of SbCl5, 9.14 g of SbCl3, and 2.84 g of Cl2. How many grams of each will be found if the mixture is transferred into a 2.00-L flask at the same temperature?


Consider the reaction between H2 and O2 at 1000 K

If 0.500 atm of H2 and 0.500 atm of O2 are allowed to come to equilibrium at this temperature, what are the partial pressures of the components?


An equilibrium is established according to the following equation


What will happen in a solution that is 0.20 M each in Hg22+,Hg22+, NO3,NO3, H+, Hg2+, and HNO2?

(a) Hg22+Hg22+ will be oxidized and NO3NO3 reduced.

(b) Hg22+Hg22+ will be reduced and NO3NO3 oxidized.

(c) Hg2+ will be oxidized and HNO2 reduced.

(d) Hg2+ will be reduced and HNO2 oxidized.

(e) There will be no change because all reactants and products have an activity of 1.


Consider the equilibrium


(a) What is the expression for the equilibrium constant (Kc) of the reaction?

(b) How must the concentration of NH3 change to reach equilibrium if the reaction quotient is less than the equilibrium constant?

(c) If the reaction were at equilibrium, how would a decrease in pressure (from an increase in the volume of the reaction vessel) affect the pressure of NO2?

(d) If the change in the pressure of NO2 is 28 torr as a mixture of the four gases reaches equilibrium, how much will the pressure of O2 change?


The binding of oxygen by hemoglobin (Hb), giving oxyhemoglobin (HbO2), is partially regulated by the concentration of H3O+ and dissolved CO2 in the blood. Although the equilibrium is complicated, it can be summarized as


(a) Write the equilibrium constant expression for this reaction.

(b) Explain why the production of lactic acid and CO2 in a muscle during exertion stimulates release of O2 from the oxyhemoglobin in the blood passing through the muscle.


The hydrolysis of the sugar sucrose to the sugars glucose and fructose follows a first-order rate equation for the disappearance of sucrose.


Rate = k[C12H22O11]

In neutral solution, k = 2.1 ×× 10−11/s at 27 °C. (As indicated by the rate constant, this is a very slow reaction. In the human body, the rate of this reaction is sped up by a type of catalyst called an enzyme.) (Note: That is not a mistake in the equation—the products of the reaction, glucose and fructose, have the same molecular formulas, C6H12O6, but differ in the arrangement of the atoms in their molecules). The equilibrium constant for the reaction is 1.36 ×× 105 at 27 °C. What are the concentrations of glucose, fructose, and sucrose after a 0.150 M aqueous solution of sucrose has reached equilibrium? Remember that the activity of a solvent (the effective concentration) is 1.


The density of trifluoroacetic acid vapor was determined at 118.1 °C and 468.5 torr, and found to be 2.784 g/L. Calculate Kc for the association of the acid.

Two Lewis structures are shown in a reaction. The first structure, which is condensed, reads, “2 C F subscript 3 C O subscript 2 H ( g ),” and is followed by a double-headed arrow. The second structure shows a partially condensed hexagonal ring shape. From the left side, in a clockwise manner, it reads “C F subscript 3 C, single bond, O, single bond, H, dotted line bond, O, double bond, C F subscript 3 C ( g ), single bond, O, single bond, H, dotted line bond, O, double bond back to the starting compound.”

Liquid N2O3 is dark blue at low temperatures, but the color fades and becomes greenish at higher temperatures as the compound decomposes to NO and NO2. At 25 °C, a value of KP = 1.91 has been established for this decomposition. If 0.236 moles of N2O3 are placed in a 1.52-L vessel at 25 °C, calculate the equilibrium partial pressures of N2O3(g), NO2(g), and NO(g).


A 1.00-L vessel at 400 °C contains the following equilibrium concentrations: N2, 1.00 M; H2, 0.50 M; and NH3, 0.25 M. How many moles of hydrogen must be removed from the vessel to increase the concentration of nitrogen to 1.1 M?


A 0.010 M solution of the weak acid HA has an osmotic pressure (see chapter on solutions and colloids) of 0.293 atm at 25 °C. A 0.010 M solution of the weak acid HB has an osmotic pressure of 0.345 atm under the same conditions.

(a) Which acid has the larger equilibrium constant for ionization

HA [HA(aq)A(aq)+H+(aq)][HA(aq)A(aq)+H+(aq)] or HB [HB(aq)H+(aq)+B(aq)][HB(aq)H+(aq)+B(aq)]?

(b) What are the equilibrium constants for the ionization of these acids?

(Hint: Remember that each solution contains three dissolved species: the weak acid (HA or HB), the conjugate base (A or B), and the hydrogen ion (H+). Remember that osmotic pressure (like all colligative properties) is related to the total number of solute particles. Specifically for osmotic pressure, those concentrations are described by molarities.)


Calculate the equilibrium constant at 25 °C for each of the following reactions from the value of ΔG° given.

(a) I2(s)+Cl2(g)2ICl(g)ΔG°=−10.88 kJI2(s)+Cl2(g)2ICl(g)ΔG°=−10.88 kJ

(b) H2(g)+I2(s)2HI(g)ΔG°=3.4 kJH2(g)+I2(s)2HI(g)ΔG°=3.4 kJ

(c) CS2(g)+3Cl2(g)CCl4(g)+S2Cl2(g)ΔG°=−39 kJCS2(g)+3Cl2(g)CCl4(g)+S2Cl2(g)ΔG°=−39 kJ

(d) 2SO2(g)+O2(g)2SO3(g)ΔG°=−141.82 kJ2SO2(g)+O2(g)2SO3(g)ΔG°=−141.82 kJ

(e) CS2(g)CS2(l)ΔG°=−1.88 kJCS2(g)CS2(l)ΔG°=−1.88 kJ


Calculate the equilibrium constant at the temperature given.

(a) O2(g)+2F2(g)2F2O(g)(T=100°C)O2(g)+2F2(g)2F2O(g)(T=100°C)

(b) I2(s)+Br2(l)2IBr(g)(T=0.0°C)I2(s)+Br2(l)2IBr(g)(T=0.0°C)

(c) 2LiOH(s)+CO2(g)Li2CO3(s)+H2O(g)(T=575°C)2LiOH(s)+CO2(g)Li2CO3(s)+H2O(g)(T=575°C)

(d) N2O3(g)NO(g)+NO2(g)(T=−10.0°C)N2O3(g)NO(g)+NO2(g)(T=−10.0°C)

(e) SnCl4(l)SnCl4(g)(T=200°C)SnCl4(l)SnCl4(g)(T=200°C)


Calculate the equilibrium constant at the temperature given.

(a) I2(s)+Cl2(g)2ICl(g)(T=100°C)I2(s)+Cl2(g)2ICl(g)(T=100°C)

(b) H2(g)+I2(s)2HI(g)(T=0.0°C)H2(g)+I2(s)2HI(g)(T=0.0°C)

(c) CS2(g)+3Cl2(g)CCl4(g)+S2Cl2(g)(T=125°C)CS2(g)+3Cl2(g)CCl4(g)+S2Cl2(g)(T=125°C)

(d) 2SO2(g)+O2(g)2SO3(g)(T=675°C)2SO2(g)+O2(g)2SO3(g)(T=675°C)

(e) CS2(g)CS2(l)(T=90°C)CS2(g)CS2(l)(T=90°C)


Consider the following reaction at 298 K:

What is the standard free energy change at this temperature? Describe what happens to the initial system, where the reactants and products are in standard states, as it approaches equilibrium.


Determine the normal boiling point (in kelvin) of dichloroethane, CH2Cl2. Find the actual boiling point using the Internet or some other source, and calculate the percent error in the temperature. Explain the differences, if any, between the two values.


Under what conditions is N2O3(g)NO(g)+NO2(g)N2O3(g)NO(g)+NO2(g) spontaneous?


At room temperature, the equilibrium constant (Kw) for the self-ionization of water is 1.00 ×× 10−14. Using this information, calculate the standard free energy change for the aqueous reaction of hydrogen ion with hydroxide ion to produce water. (Hint: The reaction is the reverse of the self-ionization reaction.)


Hydrogen sulfide is a pollutant found in natural gas. Following its removal, it is converted to sulfur by the reaction 2H2S(g)+SO2(g)38S8(s,rhombic)+2H2O(l).2H2S(g)+SO2(g)38S8(s,rhombic)+2H2O(l). What is the equilibrium constant for this reaction? Is the reaction endothermic or exothermic?


Consider the decomposition of CaCO3(s) into CaO(s) and CO2(g). What is the equilibrium partial pressure of CO2 at room temperature?


In the laboratory, hydrogen chloride (HCl(g)) and ammonia (NH3(g)) often escape from bottles of their solutions and react to form the ammonium chloride (NH4Cl(s)), the white glaze often seen on glassware. Assuming that the number of moles of each gas that escapes into the room is the same, what is the maximum partial pressure of HCl and NH3 in the laboratory at room temperature? (Hint: The partial pressures will be equal and are at their maximum value when at equilibrium.)


Benzene can be prepared from acetylene. 3C2H2(g)C6H6(g).3C2H2(g)C6H6(g). Determine the equilibrium constant at 25 °C and at 850 °C. Is the reaction spontaneous at either of these temperatures? Why is all acetylene not found as benzene?


Carbon dioxide decomposes into CO and O2 at elevated temperatures. What is the equilibrium partial pressure of oxygen in a sample at 1000 °C for which the initial pressure of CO2 was 1.15 atm?


Carbon tetrachloride, an important industrial solvent, is prepared by the chlorination of methane at 850 K.

What is the equilibrium constant for the reaction at 850 K? Would the reaction vessel need to be heated or cooled to keep the temperature of the reaction constant?


Acetic acid, CH3CO2H, can form a dimer, (CH3CO2H)2, in the gas phase.

The dimer is held together by two hydrogen bonds with a total strength of 66.5 kJ per mole of dimer.

This Lewis structure shows a six-sided ring structure composed of a methyl group single bonded to a carbon, which is double bonded to an oxygen atom in an upward position and single bonded to an oxygen atom in a downward position. The lower oxygen is single bonded to a hydrogen, which is connected by a dotted line to an oxygen that is double bonded to a carbon in an upward position. This carbon is single bonded to a methyl group to its right and to an oxygen in the upward position that is single bonded to a hydrogen that is connected by a dotted line to the double bonded oxygen on the left.

At 25 °C, the equilibrium constant for the dimerization is 1.3 ×× 103 (pressure in atm). What is ΔS° for the reaction?

Order a print copy

As an Amazon Associate we earn from qualifying purchases.


Want to cite, share, or modify this book? This book is Creative Commons Attribution License 4.0 and you must attribute OpenStax.

Attribution information
  • If you are redistributing all or part of this book in a print format, then you must include on every physical page the following attribution:
    Access for free at
  • If you are redistributing all or part of this book in a digital format, then you must include on every digital page view the following attribution:
    Access for free at
Citation information

© Sep 16, 2020 OpenStax. Textbook content produced by OpenStax is licensed under a Creative Commons Attribution License 4.0 license. The OpenStax name, OpenStax logo, OpenStax book covers, OpenStax CNX name, and OpenStax CNX logo are not subject to the Creative Commons license and may not be reproduced without the prior and express written consent of Rice University.